|
|
| | MIL-53(Al) MOF Basic information |
| Product Name: | MIL-53(Al) MOF | | Synonyms: | MIL-53(Al) MOF;MIL-53(Al), SSA: 900 - 1100 m2/g;Al(1,4-benzenedicarboxylate);Aluminum hydroxide terephthalate MOF , MIL-53(Al);MOF:MIL-53(Al);MIL-53Al-FA;1,4-Benzenedicarboxylato(2-)-κO1]hydroxyaluminum;Aluminum Terephthalate | | CAS: | 654061-20-8 | | MF: | C8H5AlO5 | | MW: | 208.1 | | EINECS: | | | Product Categories: | MOF | | Mol File: | 654061-20-8.mol |  |
| | MIL-53(Al) MOF Chemical Properties |
| density | 0.30 g/cm3 | | storage temp. | 2-8°C, sealed storage, away from moisture | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H6O4.Al.H2O/c9-7(10)5-1-2-6(4-3-5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;1H2/q;+3;/p-3 | | InChIKey | RYERTBWGRCFJTL-UHFFFAOYSA-K | | SMILES | C(C1C=CC(=CC=1)C(=O)[O-])(=O)[O-][Al+3][OH-] |
| | MIL-53(Al) MOF Usage And Synthesis |
| | MIL-53(Al) MOF Preparation Products And Raw materials |
|