|
|
| | 1,1-DICHLOROSILACYCLOBUTANE Basic information |
| | 1,1-DICHLOROSILACYCLOBUTANE Chemical Properties |
| Melting point | <0°C | | Boiling point | 113-115 °C (lit.) | | density | 1.19 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.464(lit.) | | Fp | 68 °F | | storage temp. | Flammables area | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.201 | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | InChI | InChI=1S/C3H6Cl2Si/c4-6(5)2-1-3-6/h1-3H2 | | InChIKey | PASYEMKYRSIVTP-UHFFFAOYSA-N | | SMILES | [Si]1(Cl)(Cl)CCC1 | | EPA Substance Registry System | Silacyclobutane, 1,1-dichloro- (2351-33-9) |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 16-23-26-36/37/39-45 | | RIDADR | UN 2988 4.3/PG 1 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29349990 | | Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | | Hazard Classifications | Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B Water-react 1 |
| | 1,1-DICHLOROSILACYCLOBUTANE Usage And Synthesis |
| Chemical Properties | clear colorless to slightly yellow liquid |
| | 1,1-DICHLOROSILACYCLOBUTANE Preparation Products And Raw materials |
|