2'-o-methoxyethyl inosine manufacturers
|
| | 2'-o-methoxyethyl inosine Basic information |
| Product Name: | 2'-o-methoxyethyl inosine | | Synonyms: | 2'-o-methoxyethyl inosine;2'-O-(2-Methoxyethyl) inosine;Inosine, 2'-O-(2-methoxyethyl)-;2'-O-MOE-rI;2'-o-methoxyethylinosine;2’-O-(2-Methoxy ethyl) inosine;9-((2R,3R,4R,5R)-4-Hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)tetrahydrofuran-2-yl)-3,9-dihydro-6H-purin-6-one;9-((2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(2-methoxyethoxy)tetrahydrofuran-2-yl)-1,9-dihydro-6H-purin-6-one | | CAS: | 545374-76-3 | | MF: | C13H18N4O6 | | MW: | 326.31 | | EINECS: | | | Product Categories: | Nucleosides-2'-O-MOE Nucleosides | | Mol File: | 545374-76-3.mol |  |
| | 2'-o-methoxyethyl inosine Chemical Properties |
| InChI | InChI=1S/C13H18N4O6/c1-21-2-3-22-10-9(19)7(4-18)23-13(10)17-6-16-8-11(17)14-5-15-12(8)20/h5-7,9-10,13,18-19H,2-4H2,1H3,(H,14,15,20)/t7-,9-,10-,13-/m1/s1 | | InChIKey | YVCRYUJBJVEBAK-QYVSTXNMSA-N | | SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)O)N=C2)[C@H](OCCOC)[C@@H]1O |
| | 2'-o-methoxyethyl inosine Usage And Synthesis |
| Uses | 2’-O-(2-Methoxyethyl) inosine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. | | References | [1] Robak T, Robak P. Purine nucleoside analogs in the treatment of rarer chronic lymphoid leukemias. Curr Pharm Des. 2012;18(23):3373-88. DOI:10.2174/138161212801227005 |
| | 2'-o-methoxyethyl inosine Preparation Products And Raw materials |
|