|
|
| | 4-HYDROXY-1-METHYL-2-QUINOLONE Basic information |
| | 4-HYDROXY-1-METHYL-2-QUINOLONE Chemical Properties |
| Melting point | 269-271 °C (lit.) | | Boiling point | 306.47°C (rough estimate) | | density | 1.326 | | refractive index | 1.5060 (estimate) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 4.50±1.00(Predicted) | | form | powder to crystal | | color | Light yellow to Brown to Dark green | | InChI | InChI=1S/C10H9NO2/c1-11-8-5-3-2-4-7(8)9(12)6-10(11)13/h2-6,12H,1H3 | | InChIKey | RTNPPPQVXREFKX-UHFFFAOYSA-N | | SMILES | N1(C)C2=C(C=CC=C2)C(O)=CC1=O | | CAS DataBase Reference | 1677-46-9(CAS DataBase Reference) | | EPA Substance Registry System | 2(1H)-Quinolinone, 4-hydroxy-1-methyl- (1677-46-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | FG7350000 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 | | Toxicity | mouse,LD50,intravenous,180mg/kg (180mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#01354, |
| | 4-HYDROXY-1-METHYL-2-QUINOLONE Usage And Synthesis |
| Uses | 4-Hydroxy-1-methyl-2(1H)-quinolone was used as nucleophile in electrochemical oxidation of catechols and the reaction was studied by cyclic voltammetry and controlled-potential coulometry. It was used in ceric ammonium nitrate-mediated oxidative cycloaddition of 1,3-dicarbonyls to conjugated compounds to yield substituted dihydrofurans, dihydrofurocoumarins, dihydrofuroquinolinones and dihydrofurophenalenones. It was used in the synthesis of :
- 3-(4-methoxybenzyl)-4-hydroxy-1-methylquinolinone
- 3-(benzo[d][1,3]dioxol-5-ylmethyl)-4-hydroxy-1-methylquinolin-2(1H)-one
- 3-(4-chlorobenzyl)-4-hydroxy-1-methylquinolin-2(1H)-one
- 3,3′-bis(4-chlorobenzylidene)-1,10-methylquinolin-2,20-(1H)-one
|
| | 4-HYDROXY-1-METHYL-2-QUINOLONE Preparation Products And Raw materials |
|