|
|
| | Ethyl hydrogen malonate Basic information |
| | Ethyl hydrogen malonate Chemical Properties |
| Melting point | -13°C(lit.) | | Boiling point | 106.5 °C/3 mmHg (lit.) | | density | 1.119 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.435(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly) | | pka | pK1:3.55 (25°C) | | form | Liquid | | color | Pale yellow | | Water Solubility | Miscible with water, chloroform and other solvents. | | BRN | 1758845 | | InChI | InChI=1S/C5H8O4/c1-2-9-5(8)3-4(6)7/h2-3H2,1H3,(H,6,7) | | InChIKey | HGINADPHJQTSKN-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CC(O)=O | | CAS DataBase Reference | 1071-46-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29171900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Ethyl hydrogen malonate Usage And Synthesis |
| Chemical Properties | Yellow liquid | | Uses | Ethyl Hydrogen Malonate has been shown to impair brain mitochondrial succinate and malate transport. It is also found in the extract of Hericum erinaceus mushroom which shows antitumor effects in tumo
r-bearing mice. | | Uses | Ethyl hydrogen malonate is used as a reactant for the preparation of tetramic acids through Dieckmann ring closure and organocatalytic decarboxylative Doebner-Knoevenagel reactions. It is involved in the acylation reactions and Knoevenagel condensation with aldehydes. It is also used in the preparation of gamma-lactones from olefins by intermolecular carbolactonization in presence of Mn(III) acetate as a catalyst. | | Definition | ChEBI: Monoethyl malonic acid is a dicarboxylic acid. | | Synthesis Reference(s) | Organic Syntheses, Coll. Vol. 4, p. 417, 1963 Tetrahedron Letters, 26, p. 1411, 1985 DOI: 10.1016/S0040-4039(00)99058-0 |
| | Ethyl hydrogen malonate Preparation Products And Raw materials |
|