4-Biphenylylmethyl acrylate manufacturers
- 4-Biphenylylmethyl acrylate
-
- $50.00 / 100kg
-
2025-10-13
- CAS:54140-58-8
- Min. Order: 1kg
- Purity: 99%，Electronic grade(Single metal impurity≤ 100ppb)
- Supply Ability: 100kg
|
| | 4-Biphenylylmethyl acrylate Basic information |
| Product Name: | 4-Biphenylylmethyl acrylate | | Synonyms: | 4-phenylbenzyl(methy)acrylate;4-Biphenylylmethyl acrylate;2-PROPENOIC ACID, [1,1'-BIPHENYL]-4-YLMETHYL;1,1'-biphenyl]-4-ylmethyl acrylate;2-Propenoic acid, [1,1'-biphenyl]-4-ylmethyl ester;BPMA;4-Biphenyl Methanol Acrylate;4-(Hydroxydiphenylmethyl)acrylate | | CAS: | 54140-58-8 | | MF: | C16H14O2 | | MW: | 238.28 | | EINECS: | | | Product Categories: | | | Mol File: | 54140-58-8.mol |  |
| | 4-Biphenylylmethyl acrylate Chemical Properties |
| Boiling point | 120-128 °C(Press: 0.1 Torr) | | density | 1.087±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C16H14O2/c1-2-16(17)18-12-13-8-10-15(11-9-13)14-6-4-3-5-7-14/h2-11H,1,12H2 | | InChIKey | QBECDXJGYFRACA-UHFFFAOYSA-N | | SMILES | C(OCC1=CC=C(C2=CC=CC=C2)C=C1)(=O)C=C | | EPA Substance Registry System | 2-Propenoic acid, [1,1'-biphenyl]-4-ylmethyl ester (54140-58-8) |
| | 4-Biphenylylmethyl acrylate Usage And Synthesis |
| | 4-Biphenylylmethyl acrylate Preparation Products And Raw materials |
|