| Company Name: |
Shanghai Chiral Chemistry Co.,Ltd Gold
|
| Tel: |
021-34621844 17301717660 |
| Email: |
404352994@qq.com |
| Products Intro: |
Product Name:4-(2-hydroxypropyl)phenol CAS:22805-43-2 Purity:97% Package:100g
|
|
| | 4-(2-hydroxypropyl)phenol Basic information |
| | 4-(2-hydroxypropyl)phenol Chemical Properties |
| Melting point | 84-85 °C | | Boiling point | 148-150 °C(Press: 4 Torr) | | density | 1.126±0.06 g/cm3(Predicted) | | pka | 10.21±0.26(Predicted) | | InChI | InChI=1S/C9H12O2/c1-7(10)6-8-2-4-9(11)5-3-8/h2-5,7,10-11H,6H2,1H3 | | InChIKey | RODZBUUMGRIALV-UHFFFAOYSA-N | | SMILES | C(C1C=CC(O)=CC=1)C(O)C |
| | 4-(2-hydroxypropyl)phenol Usage And Synthesis |
| | 4-(2-hydroxypropyl)phenol Preparation Products And Raw materials |
|