- 3-Nitrophenylboronic acid
-
- $100.00 / 1KG
-
2025-09-25
- CAS:13331-27-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 3-Nitrophenylboronic acid Basic information |
| | 3-Nitrophenylboronic acid Chemical Properties |
| Melting point | 284-285 °C (dec.) (lit.) | | Boiling point | 363.3±44.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Ethanol,Methanol,Ether | | form | Powder | | pka | 6.93±0.10(Predicted) | | color | Light yellow to pale brown | | Water Solubility | soluble in hot water | | Sensitive | Hygroscopic | | BRN | 2938638 | | InChI | InChI=1S/C6H6BNO4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4,9-10H | | InChIKey | ZNRGSYUVFVNSAW-UHFFFAOYSA-N | | SMILES | B(C1=CC=CC([N+]([O-])=O)=C1)(O)O | | CAS DataBase Reference | 13331-27-6(CAS DataBase Reference) | | EPA Substance Registry System | Boronic acid, (3-nitrophenyl)- (13331-27-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | RTECS | CY8980000 | | Hazard Note | Harmful | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29310095 | | Storage Class | 11 - Combustible Solids |
| | 3-Nitrophenylboronic acid Usage And Synthesis |
| Chemical Properties | White to light yellow crystal powde | | Uses | Catalyzes ene carbocyclization of acetylenic dicarbonyl compounds8 | | Uses | suzuki reaction | | Uses | 3-Nitrophenylboronic Acid is a general reagent the preparation of carbon coated copper nanoparticles and nanowires for usage in Suzuki cross coupling reactions. Also it has been used in the synthesis of oxygenated cabazoles. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 49, p. 5237, 1984 DOI: 10.1021/jo00200a045 |
| | 3-Nitrophenylboronic acid Preparation Products And Raw materials |
|