| Company Name: |
Shanghai Zerui Biotechnology Co., Ltd. Gold
|
| Tel: |
021-54580889 18321124657 |
| Email: |
1054713992@qq.com |
| Products Intro: |
Product Name:Tolterodine EP Impurity G
CAS:1554029-91-2
Purity:98% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Tolterodine EP Impurity G
CAS:1554029-91-2
Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
|
| | Tolterodine EP Impurity G Basic information |
| Product Name: | Tolterodine EP Impurity G | | Synonyms: | Tolterodine EP Impurity G;Tolterodine Impurity G;3-(2-hydroxy-5-methylphenyl)-N,N-diisopropyl-3-phenylpropan-1-amine oxide;N-(3-(2-Hydroxy-5-methylphenyl)-3-phenylpropyl)-N,N-diisopropylhydroxylammonium (Tolterodine Impurity) | | CAS: | 1554029-91-2 | | MF: | C22H32NO2+ | | MW: | 342.5 | | EINECS: | | | Product Categories: | | | Mol File: | 1554029-91-2.mol |  |
| | Tolterodine EP Impurity G Chemical Properties |
| solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Temperature Sensitive | | InChI | InChI=1S/C22H31NO2/c1-16(2)23(25,17(3)4)14-13-20(19-9-7-6-8-10-19)21-15-18(5)11-12-22(21)24/h6-12,15-17,20,25H,13-14H2,1-5H3/p+1 | | InChIKey | ODLDGMKISRXQBK-UHFFFAOYSA-O | | SMILES | C(C1C=CC=CC=1)(C1C=C(C)C=CC=1O)CC[N+](O)(C(C)C)C(C)C |
| | Tolterodine EP Impurity G Usage And Synthesis |
| Uses | Tolterodine N-oxide is an impurity of Tolterodine (T535800), a muscarinic receptor antagonist used in the treatment of urinary incontinence. |
| | Tolterodine EP Impurity G Preparation Products And Raw materials |
|