- Anilofos
-
- $1.00 / 1KG
-
2020-02-17
- CAS:64249-01-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kgs
|
| | Anilofos Basic information |
| Product Name: | Anilofos | | Synonyms: | N-amino-N-methylcarbamimidothioic acid butyl ester;S-4-Chloro-N-isoproylcarbamoylmethyl-O,O- dimethylphosphorodithioate;O,O-DIMETHYL S-(2-((4-CHLOROPHENYL)(1-METHYLETHYL)AMINO)-2-OXOETHYL);O，O-diemthyl-S-[N-(4-cholrophenyl)-N-iso-propyl carbamoyl methyl] dithiophosphate;Anilofos Solution, 100ppm;N-(4-Chlorophenyl)-2-dimethoxyphosphinothioylsulfanyl-N-propan-2-ylacetamide;S-(2-((4-Chlorophenyl)(1-methylethyl)amino)-2-oxoethyl)
O,O-dimethyl phosphorodithioate;Phosphorodithioic acid O,O-dimethyl S-(4-chloro-N-isopropylanilinocarbonylmethyl) ester | | CAS: | 64249-01-0 | | MF: | C13H19ClNO3PS2 | | MW: | 367.85 | | EINECS: | 264-756-5 | | Product Categories: | | | Mol File: | 64249-01-0.mol |  |
| | Anilofos Chemical Properties |
| Melting point | 50～55℃ | | Boiling point | 443.6±55.0 °C(Predicted) | | density | 1.322±0.06 g/cm3(Predicted) | | Fp | >100 °C | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | -0.48±0.50(Predicted) | | form | Solid | | color | White to off-white | | BRN | 2395778 | | Major Application | agriculture
environmental | | InChI | 1S/C13H19ClNO3PS2/c1-10(2)15(12-7-5-11(14)6-8-12)13(16)9-21-19(20,17-3)18-4/h5-8,10H,9H2,1-4H3 | | InChIKey | NXQDBZGWYSEGFL-UHFFFAOYSA-N | | SMILES | COP(=S)(OC)SCC(=O)N(C(C)C)c1ccc(Cl)cc1 | | CAS DataBase Reference | 64249-01-0(CAS DataBase Reference) |
| Hazard Codes | Xn;N,N,Xn | | Risk Statements | 22-51/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 | | WGK Germany | 2 | | RTECS | TD5185000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral | | Toxicity | LD50 orl-rat: 472 mg/kg PEMNDP 9,36,1991 |
| | Anilofos Usage And Synthesis |
| Uses | Agricultural chemical. | | Definition | ChEBI: Anilofos is an anilide. | | Hazard | Moderately toxic by ingestion and skin con-
tact. | | Safety Profile | Moderately toxic by ingestion andskin contact. When heated to decomposition it emits toxicvapors of NOx, POx, SOx, and Cl-. | | Synthesis | 1. Synthesis of N-isopropyl-p-chloroaniline
Add p-chloroaniline, 2-bromopropane sequentially to the reaction kettle, heating and stirring, after reacting at a certain temperature for several hours, cooling, adding sodium hydroxide solution and stirring the stratification, the oil layer is washed with water to neutral, the aqueous layer is extracted with a solvent, combining the oil layers, desolventizing to get a purplish-red liquid or distillation under reduced pressure to get a colorless liquid with a yield of 95%-98% and purity of 95%-97%.
2. Synthesis of N-chloroacetyl-N-isopropyl-p-chloroaniline
N-isopropyl-p-chloroaniline, solvent, chloroacetyl chloride in turn into the reactor, heating and stirring, reaction at a certain temperature for a few hours, add water and stirring, layering, the oil layer washed with water for several times, the water layer was extracted with solvent, the oil layer was combined, the solvent was removed to obtain a light red solid. Yield 98%, purity 96% or more.
3. The synthesis of Sa taipa phosphorus
In the reaction kettle, add N-chloroacetyl-N-isopropyl-p-chloroaniline, acid-binding agent, solvent, and O, O-dimethyl dithiophosphoric acid, at a certain temperature, stirring reaction for a few hours, the end of the reaction add water and stirring, delamination, oil layer washed with water to neutral, desolvation of the finished product of Sabauphos, yield 88% ~ 90%, purity 87% ~ 90%.
|
| | Anilofos Preparation Products And Raw materials |
|