|
|
| | (R)-(+)-1,1,2-TRIPHENYL-1,2-ETHANEDIOL Basic information |
| Product Name: | (R)-(+)-1,1,2-TRIPHENYL-1,2-ETHANEDIOL | | Synonyms: | (R)-(+)-1,1,2-TRIPHENYL-1,2-ETHANEDIOL;1,1,2-triphenyl-1,2-ethanediol;(2R)-1,1,2-Triphenyl-1,2-ethanediol;(2R)-1,1,2-Triphenylethylene glycol;(R)-1,1,2-Triphenylethylene glycol;(R)-1,1,2-Triphenylethane-1,2-diol,99%e.e.;1,2-Ethanediol, 1,1,2-triphenyl-, (2R)-;(2R)-1,1,2-triphenylethane-1,2-diol | | CAS: | 95061-46-4 | | MF: | C20H18O2 | | MW: | 290.36 | | EINECS: | | | Product Categories: | Asymmetric Synthesis;Chiral Building Blocks;Simple Alcohols (Chiral);Synthetic Organic Chemistry;Chiral Compound | | Mol File: | 95061-46-4.mol |  |
| | (R)-(+)-1,1,2-TRIPHENYL-1,2-ETHANEDIOL Chemical Properties |
| Melting point | 126 °C | | Boiling point | 452.3±40.0 °C(Predicted) | | density | 1.196±0.06 g/cm3(Predicted) | | refractive index | 220 ° (C=1, EtOH) | | storage temp. | Sealed in dry,Room Temperature | | solubility | sol dichloromethane, chloroform, THF, ethanol; insol hexane. | | form | powder to crystal | | pka | 12.87±0.29(Predicted) | | color | White to Almost white | | Optical Rotation | 217.3° (C=1.02 g/100ml,ETOH) | | InChI | InChI=1S/C20H18O2/c21-19(16-10-4-1-5-11-16)20(22,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19,21-22H/t19-/m1/s1 | | InChIKey | GWVWUZJOQHWMFB-LJQANCHMSA-N | | SMILES | C(C1=CC=CC=C1)(C1=CC=CC=C1)(O)[C@@H](C1=CC=CC=C1)O |
| | (R)-(+)-1,1,2-TRIPHENYL-1,2-ETHANEDIOL Usage And Synthesis |
| Uses | (R)-(+)-1,1,2-triphenyl-1,2-ethanediol can be used to derivatize chiral monoesters via stereoselective aldol addition; forming O-silyl orthoesters and cyclic phosphonates. | | Preparation | (R)-1,1,2-triphenylethane-1,2-diol [(R)-(1)] is easily available from commercial (R)-Mandelic Acid, which is first esterified to give methyl mandelate and then treated with Phenylmagnesium Bromide (3.5 equiv). In an analogous way, (S)-(1) is accessible from (S)-mandelic acid, which is also commercially available (eq 1).
 | | Synthesis Reference(s) | Journal of the American Chemical Society, 81, p. 493, 1959 DOI: 10.1021/ja01511a058
Synthesis, p. 415, 1987
Tetrahedron, 49, p. 1327, 1993 DOI: 10.1016/S0040-4020(01)85822-1 |
| | (R)-(+)-1,1,2-TRIPHENYL-1,2-ETHANEDIOL Preparation Products And Raw materials |
|