|
|
| | 1,4,5,8-Tetrahydro-2,7-dimethoxynaphthalene Basic information |
| Product Name: | 1,4,5,8-Tetrahydro-2,7-dimethoxynaphthalene | | Synonyms: | 2,7-DIMETHOXY-1,4,5,8-TETRAHYDRONAPHTHALENE;1,4,5,8-tetrahydro-2,7-dimethoxy-Naphthalene;2,7-Dimethoxy-1,4,5,8-tetrahydronaphthalene>Naphthalene, 1,4,5,8-tetrahydro-2,7-dimethoxy-;,4,5,8-Tetrahydro-2,7-dimethoxynaphthalene | | CAS: | 1614-82-0 | | MF: | C12H16O2 | | MW: | 192.25 | | EINECS: | | | Product Categories: | | | Mol File: | 1614-82-0.mol |  |
| | 1,4,5,8-Tetrahydro-2,7-dimethoxynaphthalene Chemical Properties |
| Melting point | 64.0 to 68.0 °C | | Boiling point | 100°C/0.2mmHg(lit.) | | density | 1.06±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C12H16O2/c1-13-11-5-3-9-4-6-12(14-2)8-10(9)7-11/h5-6H,3-4,7-8H2,1-2H3 | | InChIKey | PWPPYWWWEVISEX-UHFFFAOYSA-N | | SMILES | C1C2=C(CC=C(OC)C2)CC=C1OC | | EPA Substance Registry System | Naphthalene, 1,4,5,8-tetrahydro-2,7-dimethoxy- (1614-82-0) |
| TSCA | TSCA listed | | HS Code | 2909309090 |
| | 1,4,5,8-Tetrahydro-2,7-dimethoxynaphthalene Usage And Synthesis |
| Uses | 1,4,5,8-Tetrahydro-2,7-dimethoxynaphthalene is used in organic semiconductors for photoelectric conversion, photoelectric conversion devices, and solar cells. |
| | 1,4,5,8-Tetrahydro-2,7-dimethoxynaphthalene Preparation Products And Raw materials |
|