2-Amino-7-bromofluorene manufacturers
|
| | 2-Amino-7-bromofluorene Basic information |
| | 2-Amino-7-bromofluorene Chemical Properties |
| Melting point | 148-149 °C (lit.) | | Boiling point | 431.9±38.0 °C(Predicted) | | density | 1.559±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 3.90±0.20(Predicted) | | form | powder | | Appearance | Off-white to light yellow Solid | | Water Solubility | Sparingly soluble in water. (0.724 mg/L) | | InChI | InChI=1S/C13H10BrN/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-4,6-7H,5,15H2 | | InChIKey | RJWYTISHBMNMOZ-UHFFFAOYSA-N | | SMILES | C1C2=C(C=CC(Br)=C2)C2=C1C=C(N)C=C2 | | CAS DataBase Reference | 6638-60-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | LL5150050 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Amino-7-bromofluorene Usage And Synthesis |
| Uses | It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuffs. | | General Description | Spectral characteristics of inclusion complexation of 2-amino-7-bromofluorene in aqueous β-cyclodextrin solution were evaluated. Fluorescence quenching of 2-amino-7-bromofluorene by chloromethanes (CH2Cl2, CHCl3, CCl4) in various solvents was studied. |
| | 2-Amino-7-bromofluorene Preparation Products And Raw materials |
|