|
|
| | 2245084-40-4 Basic information |
| Product Name: | 2245084-40-4 | | Synonyms: | Spiro[6H-cyclopenta[b]pyridine-6,4'-piperidine]-1'-carboxylic acid, 5,7-dihydro-5-oxo-, 1,1-dimethylethyl ester;tert-Butyl 5-oxo-5,7-dihydrospiro[cyclopenta[b]pyridine-6,4';tert-Butyl 5-oxo-5,7-dihydrospiro[cyclopenta[b]pyridine-6,4'-piperidine]-1'-carboxylate | | CAS: | 2245084-40-4 | | MF: | C17H22N2O3 | | MW: | 302.37 | | EINECS: | | | Product Categories: | | | Mol File: | 2245084-40-4.mol |  |
| | 2245084-40-4 Chemical Properties |
| Boiling point | 439.8±45.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 2.83±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C17H22N2O3/c1-16(2,3)22-15(21)19-9-6-17(7-10-19)11-13-12(14(17)20)5-4-8-18-13/h4-5,8H,6-7,9-11H2,1-3H3 | | InChIKey | IIEMEFZYFPCYBC-UHFFFAOYSA-N | | SMILES | C12CC3(CCN(C(OC(C)(C)C)=O)CC3)C(=O)C1=CC=CN=2 |
| | 2245084-40-4 Usage And Synthesis |
| | 2245084-40-4 Preparation Products And Raw materials |
|