|
|
| | 9-Fluorenone-2-carboxylic acid Basic information |
| | 9-Fluorenone-2-carboxylic acid Chemical Properties |
| Melting point | >300 °C (lit.) | | Boiling point | 325.61°C (rough estimate) | | density | 1.2337 (rough estimate) | | refractive index | 1.5400 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 3.85±0.20(Predicted) | | form | Fine Powder | | color | Yellow | | InChI | 1S/C14H8O3/c15-13-11-4-2-1-3-9(11)10-6-5-8(14(16)17)7-12(10)13/h1-7H,(H,16,17) | | InChIKey | BJCTXUUKONLPPK-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc2-c3ccccc3C(=O)c2c1 | | CAS DataBase Reference | 784-50-9(CAS DataBase Reference) | | NIST Chemistry Reference | 9-Fluorenone-2-carboxylic acid(784-50-9) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29183000 | | Storage Class | 13 - Non Combustible Solids |
| | 9-Fluorenone-2-carboxylic acid Usage And Synthesis |
| Chemical Properties | yellow fine powder | | Uses | 9-Fluorenone-2-carboxylic Acid (cas# 784-50-9) is a compound useful in organic synthesis. | | Synthesis Reference(s) | Journal of the American Chemical Society, 70, p. 3958, 1948 DOI: 10.1021/ja01191a530
Organic Syntheses, Coll. Vol. 3, p. 420, 1955 | | Synthesis | General procedure for the synthesis of 9-fluorenone-2-carboxylic acid from the compound (CAS: 3096-44-4): potassium hydroxide (1.6 g, 29.4 mmol) was added to a mixture of methanol (7 mL) and water (7 mL) containing compound 12 (200 mg, 0.98 mmol), and the reaction mixture was stirred for 6 hours at 110 °C. Upon completion of the reaction, the mixture was cooled to room temperature and subsequently concentrated under reduced pressure. The pH was adjusted to 3 with 1 N hydrochloric acid and the mixture was extracted with ethyl acetate (30 mL x 3). The organic layers were combined, dried with anhydrous sodium sulfate, filtered and concentrated to afford the target product 9-fluorenone-2-carboxylic acid (200 mg, 91% yield) as a yellow solid.1H NMR (400 MHz, DMSO-d6) δ 13.30 (s, 1H), 8.19 (d, J = 7.6 Hz, 1H), 8.03 (s, 1H), 7.97-9.89 ( m, 2H), 7.72-7.64 (m, 2H), 7.50-7.44 (m, 1H). | | References | [1] Bioorganic and Medicinal Chemistry, 2016, vol. 24, # 22, p. 5861 - 5872
[2] Patent: CN104557862, 2017, B. Location in patent: Paragraph 0102-0104; 0109-0110 |
| | 9-Fluorenone-2-carboxylic acid Preparation Products And Raw materials |
|