| Company Name: |
Shanghai UCHEM Inc. |
| Tel: |
+86-18930848214 +86-021-56762820 |
| Email: |
sales@myuchem.com |
|
| | 1,2,4,5-Cyclohexanetetrayl tetraacetate Basic information |
| Product Name: | 1,2,4,5-Cyclohexanetetrayl tetraacetate | | Synonyms: | 1,2,4,5-Cyclohexanetetrayl tetraacetate;1,2,4,5-Cyclohexanetetrol, 1,2,4,5-tetraacetate | | CAS: | 92298-57-2 | | MF: | C14H20O8 | | MW: | 316.3 | | EINECS: | | | Product Categories: | | | Mol File: | 92298-57-2.mol |  |
| | 1,2,4,5-Cyclohexanetetrayl tetraacetate Chemical Properties |
| InChI | InChI=1S/C14H20O8/c1-7(15)19-11-5-13(21-9(3)17)14(22-10(4)18)6-12(11)20-8(2)16/h11-14H,5-6H2,1-4H3 | | InChIKey | MCRKABDCFOWPHD-UHFFFAOYSA-N | | SMILES | C1(OC(=O)C)CC(OC(=O)C)C(OC(=O)C)CC1OC(=O)C |
| | 1,2,4,5-Cyclohexanetetrayl tetraacetate Usage And Synthesis |
| | 1,2,4,5-Cyclohexanetetrayl tetraacetate Preparation Products And Raw materials |
|