|
|
| | Topiramate Impurity 6 Basic information |
| Product Name: | Topiramate Impurity 6 | | Synonyms: | Topiramate Impurity 2 (Topiramate EP Impurity B);Topiramate EP Impurity B;2,3:4,5-Bis-O-(1-methylethylidene)-β-D-fructopyranose 1-[[(diethylamino)carbonyl]sulfamate];β-D-Fructopyranose, 2,3:4,5-bis-O-(1-methylethylidene)-, 1-[[(diethylamino)carbonyl]sulfamate];((3aS,5aR,8aR,8bS)-2,2,7,7-tetramethyltetrahydro-3aH-bis([1,3]dioxolo)[4,5-b:4',5'-d]pyran-3a-yl)methyl diethylcarbamoylsulfamate;Topiramte EP Impurity B;1-O-[(Diethylcarbamoyl)sulfamoyl]-2,3:4,5-bis-O-(1-methylethylidene)-β-D-fructopyranose;2,3:4,5-Bis-O-(1-methylethylidene)-β-D-fructopyranose 1-[[(diethylamino)carbonyl]sulfamate | | CAS: | 876403-98-4 | | MF: | C17H30N2O9S | | MW: | 438.49 | | EINECS: | | | Product Categories: | | | Mol File: | 876403-98-4.mol |  |
| | Topiramate Impurity 6 Chemical Properties |
| Melting point | 110 - 112°C | | density | 1.267±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Sparingly) | | pka | 4.57±0.70(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1/C17H30N2O9S/c1-7-19(8-2)14(20)18-29(21,22)24-10-17-13(27-16(5,6)28-17)12-11(9-23-17)25-15(3,4)26-12/h11-13H,7-10H2,1-6H3,(H,18,20)/t11-,12-,13+,17+/s3 | | InChIKey | ACYUMNAWFQMILA-ZNWOURNDNA-N | | SMILES | C([C@]12OC(C)(C)O[C@@]1([H])[C@]1([H])OC(C)(C)O[C@]1([H])CO2)OS(=O)(=O)NC(=O)N(CC)CC |&1:1,7,9,16,r| |
| | Topiramate Impurity 6 Usage And Synthesis |
| Uses | 2,3:4,5-Bis-O-(1-methylethylidene)-β-D-fructopyranose 1-[[(diethylamino)carbonyl]sulfamate] is an impurity of Topiramate (T540250), which is used as an anti-convulsant. |
| | Topiramate Impurity 6 Preparation Products And Raw materials |
|