(S)-2-CHLORO-1-(2,4-DICHLOROPHENYL)ETHANOL manufacturers
|
| | (S)-2-CHLORO-1-(2,4-DICHLOROPHENYL)ETHANOL Basic information | | Uses |
| Product Name: | (S)-2-CHLORO-1-(2,4-DICHLOROPHENYL)ETHANOL | | Synonyms: | Benzenemethanol,2,4-dichloro-a-(chloromethyl)-,(aS)-;(S)-alpha-(Chloromethyl)-2,4-dichlorobenzyl Alcohol;(S)-2-CHLORO-1-(2,4-DICHLOROPHENYL)ETHANOL;(S)-2,4-Dichloro-alpha-(chloromethyl)-benzenemethanol;(S)-2-Chloro-1-(2,4-dichlorophenyl)ethan-1-ol;(S)-2,4-Dichloro-alp;S)-2,4-Dichloro-alpha-(chloromethyl)-benzenemethano;(S)-2,4-Dichloro-alpha-(chloromethyl)benzyl Alcohol | | CAS: | 126534-31-4 | | MF: | C8H7Cl3O | | MW: | 225.5 | | EINECS: | 256-974-4 | | Product Categories: | intermediate | | Mol File: | 126534-31-4.mol |  |
| | (S)-2-CHLORO-1-(2,4-DICHLOROPHENYL)ETHANOL Chemical Properties |
| Melting point | 62 °C | | Boiling point | 323.3±37.0 °C(Predicted) | | density | 1.447±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.45±0.20(Predicted) | | form | powder to crystal | | color | White to Light yellow | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C8H7Cl3O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3,8,12H,4H2/t8-/s3 | | InChIKey | XHEPANNURIQWRM-SBYBRXNCNA-N | | SMILES | C1C=C([C@H](O)CCl)C(Cl)=CC=1Cl |&1:3,r| |
| | (S)-2-CHLORO-1-(2,4-DICHLOROPHENYL)ETHANOL Usage And Synthesis |
| Uses | (1S)-2-Chloro-1-(2,4-dichlorophenyl)ethanol is a building block used in synthetic organic chemistry such as in the asymmetric chemoenzymatic synthesis of miconazole and econazole enantiomers. | | Uses | (1S)?-?2-?Chloro-?1-?(2,?4-?dichlorophenyl)?ethanol is a building block used in synthetic organic chemistry such as in the asymmetric chemoenzymatic synthesis of miconazole and econazole enantiomers. |
| | (S)-2-CHLORO-1-(2,4-DICHLOROPHENYL)ETHANOL Preparation Products And Raw materials |
|