4'-CHLORO-2,2':6',2''-TERPYRIDINE manufacturers
|
| | 4'-CHLORO-2,2':6',2''-TERPYRIDINE Basic information |
| Product Name: | 4'-CHLORO-2,2':6',2''-TERPYRIDINE | | Synonyms: | 4'-CHLORO-2,2':6',2''-TERPYRIDINE;4'-CHLORO-2,2'6'2''-TERPYRIDINE;4-Chloro-2,6-di(pyridin-2-yl)pyridine ,99%;4''-CHLORO-2,2'':6'',2''-TERPYRIDINE 99%;4'-Chloro-2,2':6',2''-terpyridine,99%;4-Chloro-2,6-di(pyridin-2-yl)pyridine;2,2':6',2''-Terpyridine,4'-chloro-;4'-Chloro-2,2,2':6',2''-terpyridine | | CAS: | 128143-89-5 | | MF: | C15H10ClN3 | | MW: | 267.71 | | EINECS: | 626-940-7 | | Product Categories: | C9 to C46Heterocyclic Building Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks;Pyridines;Building Blocks;C13 to C40;C7 to C18;Chemical Synthesis;Halogenated Heterocycles;Heterocyclic Building Blocks | | Mol File: | 128143-89-5.mol |  |
| | 4'-CHLORO-2,2':6',2''-TERPYRIDINE Chemical Properties |
| Melting point | 148-150 °C(lit.) | | Boiling point | 416.73°C (rough estimate) | | density | 1.2245 (rough estimate) | | refractive index | 1.6010 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Crystalline Powder | | pka | 4.22±0.22(Predicted) | | color | Brown | | Water Solubility | Slightly soluble in water. | | λmax | 278nm(CH3CN)(lit.) | | BRN | 3613386 | | InChI | InChI=1S/C15H10ClN3/c16-11-9-14(12-5-1-3-7-17-12)19-15(10-11)13-6-2-4-8-18-13/h1-10H | | InChIKey | AHEMFMCEBIJRMU-UHFFFAOYSA-N | | SMILES | C1(C2=NC(C3=NC=CC=C3)=CC(Cl)=C2)=NC=CC=C1 |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-39 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 29333990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 4'-CHLORO-2,2':6',2''-TERPYRIDINE Usage And Synthesis |
| Chemical Properties | brown crystalline powder | | Uses | 4'-Chloro-2,2':6',2''-terpyridine is widely utilized in the field of supramolecular chemistry, which is used to manufacture double helicates, dendrimers, micelles and metallo-supramolecular polymers. It is used to synthesize the mono- and bis-terpyridines. It is actively involved in Williamson type ether reactions alpha,μ-bishydroxy-functionalized poly(propylene oxide). | | General Description | 4′-Chloro-2,2′:6′,2′′-terpyridine (4′-Cltpy, Cltpy, Cl-terpy) is a tridentate ligand that contains a terpyridine (tpy) site with a Cl site at the 4 -position. It coordinates with various metal ions through these two sites to form different coordination polymers. Crystal structure study shows terpyridine unit of Cltpy adopts a trans, trans conformation. Mol-ecules assemble themselves into stacked columns along the b axis, with an inter-planar distance of 3.51. It undergoes Williamson type ether reactions with α,ω-bishydroxy-functionalized poly(propylene oxide). It undergoes Williamson type reaction with α-hydroxy-ω-carboxy-functionalized poly(ethylen-oxide) to afford monoterpyridine terminated telechelics. |
| | 4'-CHLORO-2,2':6',2''-TERPYRIDINE Preparation Products And Raw materials |
|