- Fmoc-D-NvaL-OH
-
- $0.00/ kg
-
2026-01-20
- CAS:144701-24-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- FMOC-D-NVA-OH
-
- $1.00 / 1KG
-
2019-07-06
- CAS:144701-24-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | FMOC-D-NVA-OH Basic information |
| Product Name: | FMOC-D-NVA-OH | | Synonyms: | (2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanoic acid;Fmoc-D-NVal-OH;Fmoc-D-norvaline99%;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-D-NORVALINE;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-D-2-AMINOPENTANOIC ACID;N-ALPHA-FMOC-D-NORVALINE;RARECHEM EM WB 0171;FMOC-D-APE(2)-OH | | CAS: | 144701-24-6 | | MF: | C20H21NO4 | | MW: | 339.39 | | EINECS: | | | Product Categories: | | | Mol File: | 144701-24-6.mol |  |
| | FMOC-D-NVA-OH Chemical Properties |
| Melting point | 152-154°C | | Boiling point | 557.9±33.0 °C(Predicted) | | density | 1.230±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | form | powder | | pka | 3.91±0.20(Predicted) | | Appearance | White to off-white Solid | | Major Application | peptide synthesis | | InChI | 1S/C20H21NO4/c1-2-7-18(19(22)23)21-20(24)25-12-17-15-10-5-3-8-13(15)14-9-4-6-11-16(14)17/h3-6,8-11,17-18H,2,7,12H2,1H3,(H,21,24)(H,22,23)/t18-/m1/s1 | | InChIKey | JBIJSEUVWWLFGV-GOSISDBHSA-N | | SMILES | N([C@H](CCC)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | FMOC-D-NVA-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Fmoc-d-nva-oh is a useful intermediate for organic synthesis. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-D-NVA-OH Preparation Products And Raw materials |
|