|
|
| | 2-Chloro-1,3,2-dioxaphospholane Basic information |
| Product Name: | 2-Chloro-1,3,2-dioxaphospholane | | Synonyms: | 1,3,2-Dioxaphospholane, 2-chloro-;1,3,2-Dioxaphosphorane.2-chloro-;2-dioxaphospholane,2-chloro-3;Ethylenephosphorochloridite;AURORA KA-1222;ETHYLENE CYCL-CHLOROPHOSPHITE;ETHYLENE CYCLO-CHLOROPHOSPHITE;ETHYLENE CHLOROPHOSPHITE | | CAS: | 822-39-9 | | MF: | C2H4ClO2P | | MW: | 126.48 | | EINECS: | 212-499-4 | | Product Categories: | Biochemistry;Nucleosides, Nucleotides & Related Reagents;Phosphorylating and Phosphorothioating Agents;Phosphorylation;Protecting Agents, Phosphorylating Agents & Condensing Agents;Synthetic Organic Chemistry;Phosphorylating and Phosphitylating Agents | | Mol File: | 822-39-9.mol |  |
| | 2-Chloro-1,3,2-dioxaphospholane Chemical Properties |
| Melting point | -28°C(lit.) | | Boiling point | 62 °C/20 mmHg (lit.) | | density | 1.422 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.489(lit.) | | Fp | 158 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly) | | form | clear liquid | | color | Colorless to Light yellow | | Sensitive | Moisture Sensitive | | BRN | 506179 | | Stability: | Extremely Moisture Sensitive | | InChI | 1S/C2H4ClO2P/c3-6-4-1-2-5-6/h1-2H2 | | InChIKey | OLSFRDLMFAOSIA-UHFFFAOYSA-N | | SMILES | ClP1OCCO1 | | CAS DataBase Reference | 822-39-9(CAS DataBase Reference) | | NIST Chemistry Reference | Ethylene chlorophosphite(822-39-9) | | EPA Substance Registry System | 1,3,2-Dioxaphospholane, 2-chloro- (822-39-9) |
| Hazard Codes | C | | Risk Statements | 14-34-37 | | Safety Statements | 26-36/37/39-45-8-25 | | RIDADR | UN 3264 8/PG 2 | | WGK Germany | 3 | | F | 1-10 | | Hazard Note | Highly reactive cyclic phosphitylating reagent which | | TSCA | TSCA listed | | HS Code | 2934.99.9001 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B
STOT SE 3 |
| | 2-Chloro-1,3,2-dioxaphospholane Usage And Synthesis |
| Chemical Properties | Clear Colourless Oil | | Uses | Highly reactive cyclic phosphitylating reagent which provides fast coupling rates, and hydrolytic cleavage occurs more readily than with acyclic analogs | | Uses | Ethylene chlorophosphite acts as a phosphitylating agent involved in the preparation of phosphocholine and spirophosphoranes. For example, it is used in the phosphorylation of p-tert-butyl(thia)calixarenes. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | 2-Chloro-1,3,2-dioxaphospholane Preparation Products And Raw materials |
|