|
|
| | 5,10,15,20-TETRA(4-PYRIDYL)-21H,23H-PORPHINE Basic information |
| Product Name: | 5,10,15,20-TETRA(4-PYRIDYL)-21H,23H-PORPHINE | | Synonyms: | 2,7,12,17-tetrakis(pyridin-4-yl)-21,22,23,24-tetraazapentacyclo[16.2.1.1^{3,6}.1^{8,11}.1^{13,16}]tetracosa-1,3,5,7,9,11,13,15,17,19-decaene;5,10,15,20-Tetra(4-pyridyl)-21H,23H-porphine 97%;COTPYP;4-PYP;5,10,15,20-tetrapyridin-4-yl-21,22-dihydroporphyrin;5,10,15,20-Tetra(4-pyridyl);23h-porphine,5,10,15,20-tetra-4-pyridinyl-21;MESO-TETRA(4-PYRIDYL)PORPHINE | | CAS: | 16834-13-2 | | MF: | C40H26N8 | | MW: | 618.69 | | EINECS: | 240-858-5 | | Product Categories: | organic building block;Standards and Kits;Biochemistry;Synthetic Porphyrins;porphine (porphyrin) ligand;Analytical Chemistry;Chelating Reagents;Porphines;Porphyrin Building Blocks;Porphyrins;Natural Porphyrins and Derivitives;Organics | | Mol File: | 16834-13-2.mol |  |
| | 5,10,15,20-TETRA(4-PYRIDYL)-21H,23H-PORPHINE Chemical Properties |
| density | 1.335±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | purple | | λmax | 442 nm | | BRN | 635257 | | InChIKey | DNZSHSJERXNJGX-XXDGMDECSA-N | | SMILES | C1(C2C=CN=CC=2)=C2N=C(C(C3C=CN=CC=3)=C3NC(=C(C4C=CN=CC=4)C4=NC(=C(C5C=CN=CC=5)C5NC1=CC=5)C=C4)C=C3)C=C2 |c:18,t:7,21,32| | | EPA Substance Registry System | 21H,23H-Porphine, 5,10,15,20-tetra-4-pyridinyl- (16834-13-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10 | | TSCA | TSCA listed | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids |
| | 5,10,15,20-TETRA(4-PYRIDYL)-21H,23H-PORPHINE Usage And Synthesis |
| Description | 5,10,15,20-(tetra-4-pyridyl)porphyrin is a pyridine substituted synthetic porphyrin. It can act as a sensitive amperometric sensor. | | Chemical Properties | Purple to dark purple solid | | Uses | 5,10,15,20-Tetra(4-pyridyl)-21H,23H-porphine is used in the making of coordination catalysts. | | General Description | 5,10,15,20-tetra-4-pyridyl-21H,23H-porphine (H2TPyP)can react with [Re6(μ3-Se)8(Pet3)5(NCMe]2+ and 2,4,6-tri-4-pyridyl-1,3,5-triazine to form tri- and tetra complexes. 1 Trace amounts of nitroaromatic explosives can be detected by porphyrin functionalized graphene. It behaves as a sensitive amperometric sensor. 2 | | Purification Methods | Purify it by chromatography on alumina (neutral, Grade I), with CHCl3/MeOH (80:20) followed by recrystallisation from CH2Cl2/MeOH [Yamashita et al. J Phys Chem 91 3055 1987]. [Kalyanasundaram Inorg Chem 23 2453 1984, Okuno et al. Synthesis 537 1980.] |
| | 5,10,15,20-TETRA(4-PYRIDYL)-21H,23H-PORPHINE Preparation Products And Raw materials |
|