|
|
| | Methyl [E]-2-[3-(S)-[3-[2-(7-Chloro-2-quinolinyl)ethenyl]phenyl]-3-hydroxypropyl]benzoate Basic information |
| | Methyl [E]-2-[3-(S)-[3-[2-(7-Chloro-2-quinolinyl)ethenyl]phenyl]-3-hydroxypropyl]benzoate Chemical Properties |
| Melting point | 88-90°C | | Boiling point | 644.0±55.0 °C(Predicted) | | density | 1.278±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 14.11±0.20(Predicted) | | form | Solid | | color | Pale Yellow to Yellow | | InChIKey | KPCSDMZEMDMWKQ-MHZLTWQESA-N | | SMILES | C(OC)(=O)C1=CC=CC=C1CC[C@@H](C1=CC=CC(C=CC2C=CC3C(N=2)=CC(Cl)=CC=3)=C1)O |
| | Methyl [E]-2-[3-(S)-[3-[2-(7-Chloro-2-quinolinyl)ethenyl]phenyl]-3-hydroxypropyl]benzoate Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | An intermediate in the synthesis of Montelukast. |
| | Methyl [E]-2-[3-(S)-[3-[2-(7-Chloro-2-quinolinyl)ethenyl]phenyl]-3-hydroxypropyl]benzoate Preparation Products And Raw materials |
|