| Company Name: |
Shanghai Hongye Biotechnology Co. Ltd
|
| Tel: |
400-9205774 |
| Email: |
sales@glpbio.cn |
| Products Intro: |
Product Name:SB 215505
CAS:162100-15-4
Purity:>98% Package:1mg;10mg;50mg;100mg;
|
|
| | SB 215505 Basic information |
| Product Name: | SB 215505 | | Synonyms: | 6-Chloro-2,3-dihydro-5-methyl-N-5-quinolinyl-1H-indole-1-carboxamide;6-chloro-5-methyl-N-quinolin-5-yl-2,3-dihydroindole-1-carboxamide;1H-Indole-1-carboxamide, 6-chloro-2,3-dihydro-5-methyl-N-5-quinolinyl-;6-Chloro-5-methyl-N-(quinolin-5-yl)indoline-1-carboxamide;SB 215505,SB215505;6-Chloro-5-methyl-N-(quinolin-5-yl)indoline-1-carboxamide , SB-215505 | | CAS: | 162100-15-4 | | MF: | C19H16ClN3O | | MW: | 337.8 | | EINECS: | | | Product Categories: | | | Mol File: | 162100-15-4.mol |  |
| | SB 215505 Chemical Properties |
| Boiling point | 600.9±55.0 °C(Predicted) | | density | 1.385±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: ~11 mg/mL at 60 °C, soluble | | form | solid | | pka | 12.87±0.20(Predicted) | | color | off-white | | InChI | 1S/C19H16ClN3O/c1-12-10-13-7-9-23(18(13)11-15(12)20)19(24)22-17-6-8-21-16-5-3-2-4-14(16)17/h2-6,8,10-11H,7,9H2,1H3,(H,21,22,24) | | InChIKey | BPVGSWDWIRIUME-UHFFFAOYSA-N | | SMILES | Cc1cc2CCN(C(=O)Nc3ccnc4ccccc34)c2cc1Cl |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | SB 215505 Usage And Synthesis |
| Uses | SB-215505 is a selective 5-HT2B serotonin receptor antagonist. | | Biological Activity | Selective 5-HT2B serotonin receptor antagonist; 100-fold higher affinity at 2B versus 2C. | | in vivo | SB-215505 (0.1-1.0 mg/kg; i.p.; two doses) dose-dependently increases wakefulness (W) and decreases IS, PS, SWS-2[2]. | Animal Model: | Male Sprague-Dawley rats weighing 230-260 g[2] | | Dosage: | 0.1, 0.3 and 1.0 mg/kg | | Administration: | IP; two doses (4 days between two doses) | | Result: | Dose-dependently increased wakefulness (W) and decreased intermediate stage of sleep (IS), paradoxical sleep (PS), SWS-2.
|
| | IC 50 | 5-HT2B Receptor: 8.3 (pKi); 5-HT2A Receptor: 6.77 (pKi); 5-HT2C Receptor: 7.66 (pKi) |
| | SB 215505 Preparation Products And Raw materials |
|