| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:1,1,1,3,3,3-Hexakis(diMethylaMino)diphosphazeniuM tetrafluoroborate
CAS:137334-98-6
Purity:>=98.0% (T) Package:5G
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:1,1,1,3,3,3-Hexakis(dimethylamino)diphosphazenium tetrafluoroborate purum, >=98.0% (T)
CAS:137334-98-6
Remarks:SR16000005
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:1,1,1,3,3,3-Hexakis(dimethylamino)diphosphazenium tetrafluoroborate
CAS:137334-98-6
Purity:>=98.0% (T) Package:5G Remarks:52586-5G
|
| Company Name: |
Shanghai EFE Biological Technology Co., Ltd.
|
| Tel: |
021-65675885 18964387627 |
| Email: |
info@efebio.com |
| Products Intro: |
Product Name:Phosphazenium tetrafluoroborate P2-BF4
CAS:137334-98-6
Purity:95% Package:1g;5g;25g
|
|
| | 1 1 1 3 3 3-HEXAKIS(DIMETHYLAMINO)DI- Basic information |
| Product Name: | 1 1 1 3 3 3-HEXAKIS(DIMETHYLAMINO)DI- | | Synonyms: | 1 1 1 3 3 3-HEXAKIS(DIMETHYLAMINO)DI-;1,1,1,3,3,3-Hexakis(dimethylamino)diphosphazenium tetrafluoroborate purum, >=98.0% (T);1,1,1,3,3,3-hexakis(dimethylamino)di-phosphazenium bf4;Phosphazenium tetrafluoroborate P2-BF4, Bis[tris(dimethylamino)phosphoranylidene]ammonium tetrafluoroborate;1,1,1,3,3,3-Hexakis(dimethylamino)diphosphazenium tetrafluoroborate >=98.0% (T) | | CAS: | 137334-98-6 | | MF: | C12H36N7P2.BF4 | | MW: | 427.22 | | EINECS: | | | Product Categories: | | | Mol File: | 137334-98-6.mol |  |
| | 1 1 1 3 3 3-HEXAKIS(DIMETHYLAMINO)DI- Chemical Properties |
| Melting point | ≥260 °C (lit.) | | form | solid | | BRN | 5470923 | | InChI | 1S/C12H36N7P2.BF4/c1-14(2)20(15(3)4,16(5)6)13-21(17(7)8,18(9)10)19(11)12;2-1(3,4)5/h1-12H3;/q+1;-1 | | InChIKey | DPIDWCQJGWFENO-UHFFFAOYSA-N | | SMILES | F[B-](F)(F)F.CN(C)P(=[N+]=P(N(C)C)(N(C)C)N(C)C)(N(C)C)N(C)C |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38-34-14 | | Safety Statements | 26-36-45-36/37/39-27 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 1 1 1 3 3 3-HEXAKIS(DIMETHYLAMINO)DI- Usage And Synthesis |
| | 1 1 1 3 3 3-HEXAKIS(DIMETHYLAMINO)DI- Preparation Products And Raw materials |
|