|
|
| | 2 5-BIS(OCTYLOXY)TEREPHTHALALDEHYDE 98 Basic information |
| Product Name: | 2 5-BIS(OCTYLOXY)TEREPHTHALALDEHYDE 98 | | Synonyms: | 2,5-dioctoxyterephthalaldehyde;2 5-BIS(OCTYLOXY)TEREPHTHALALDEHYDE 98;2,5-BIS(OCTYLOXY)TEREPHTHALADEHYDE, 98%;2,5-Bis(octyloxy)terephthalaldehyde 98%;2,5-Bis-octyloxy-benzene-1,4-dicarbaldehyde;[1,4-Benzenedicarboxaldehyde,2,5-bis(octyloxy)-];5-Bis(octyloxy)terephthalaldehyde;2,5-Bis(octyloxy)terephthaldeyde | | CAS: | 123440-34-6 | | MF: | C24H38O4 | | MW: | 390.56 | | EINECS: | | | Product Categories: | Organic Electronics and Photonics;Polyphenylenevinylene (PPV, CN-PPV) Monomers;Synthetic Tools and Reagents | | Mol File: | 123440-34-6.mol |  |
| | 2 5-BIS(OCTYLOXY)TEREPHTHALALDEHYDE 98 Chemical Properties |
| Melting point | 76-79 °C (lit.) | | Boiling point | 529.2±50.0 °C(Predicted) | | density | 0.996±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C24H38O4/c1-3-5-7-9-11-13-15-27-23-17-22(20-26)24(18-21(23)19-25)28-16-14-12-10-8-6-4-2/h17-20H,3-16H2,1-2H3 | | InChIKey | HBPJKNOOUOGSOG-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1cc(OCCCCCCCC)c(cc1OCCCCCCCC)C([H])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2 5-BIS(OCTYLOXY)TEREPHTHALALDEHYDE 98 Usage And Synthesis |
| Uses | Monomeric precursor for cyano-PPV light-emitting polymer. |
| | 2 5-BIS(OCTYLOXY)TEREPHTHALALDEHYDE 98 Preparation Products And Raw materials |
|