|
|
| | 1,3,5-Tris(4-iodophenyl)benzene Basic information |
| Product Name: | 1,3,5-Tris(4-iodophenyl)benzene | | Synonyms: | 1 3 5-TRIS(4-IODOPHENYL)BENZENE) 90;1,3,5-Tris(4-iodophenyl)benzene 97%;tert-butyl 3-iodoindazole-1-carboxylate;1,1':3',1''-Terphenyl, 4,4''-diiodo-5'-(4-iodophenyl)-;1 3 5-TRIS(4-IODOPHENYL)BENZENE) 90 ISO 9001:2015 REACH;1,3,5-Tri(4-iodophenyl)benzene;1,3,5-TRIS(4-IODOPHENYL)BENZENE;CAS:151417-38-8 | | CAS: | 151417-38-8 | | MF: | C24H15I3 | | MW: | 684.09 | | EINECS: | 625-108-0 | | Product Categories: | Organic Electronics and Photonics;Synthetic Intermediates;Synthetic Tools and Reagents | | Mol File: | 151417-38-8.mol |  |
| | 1,3,5-Tris(4-iodophenyl)benzene Chemical Properties |
| Melting point | 254-260 °C (lit.) | | Boiling point | 600.3±55.0 °C(Predicted) | | density | 1.946±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C24H15I3/c25-22-7-1-16(2-8-22)19-13-20(17-3-9-23(26)10-4-17)15-21(14-19)18-5-11-24(27)12-6-18/h1-15H | | InChIKey | KGLWDSJGGFTHHD-UHFFFAOYSA-N | | SMILES | C1(C2=CC(C3=CC=C(I)C=C3)=CC(C3=CC=C(I)C=C3)=C2)=CC=C(I)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HS Code | 29039990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | 1,3,5-Tris(4-iodophenyl)benzene Usage And Synthesis |
| Uses | Building block in a synthesis of C3-symmetric nano-sized polyaromatics and molecular propellers. | | Synthesis | Example 1 (Preparation of 1,3,5-tris(4-iodophenyl)benzene): 116 g of 1,3,5-triphenylbenzene, 19 mL of concentrated sulfuric acid (as a catalyst), and 1520 mL of 80% acetic acid (as a reaction solvent) were sequentially added to a 2L three-necked flask. The reaction mixture was heated to 70 °C under stirring conditions. Subsequently, 143 g of iodine and 69.3 g of periodate were added in batches over a period of about 2.5 hours (Note: in the original text, "n-stereo acid" should be "periodate"). After the addition, the reaction was continued with stirring for 6 hours, during which a white precipitate was generated. At the end of the reaction, toluene was added to the reaction mixture to dissolve the precipitate and separate the toluene layer from the water layer. The toluene layer was washed with aqueous sodium bicarbonate and aqueous sodium thiosulfate in turn. The washed organic layer was concentrated and purified by silica gel column chromatography, and finally recrystallized with ethanol/toluene mixed solvent to obtain 34.6 g of the target product 1,3,5-tris(4-iodophenyl)benzene as white needle-like crystals in 13.3% yield. | | References | [1] Patent: EP1826837, 2007, A1 |
| | 1,3,5-Tris(4-iodophenyl)benzene Preparation Products And Raw materials |
|