| Company Name: |
Alchem Pharmtech,Inc. |
| Tel: |
8485655694 |
| Email: |
sales@alchempharmtech.com |
| Products Intro: |
Product Name:N-Ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-(2-hydroxyethyl)octane-1-sulfonamide
CAS:1691-99-2
Purity:97+% Package:1g;10g;100g;;1kg Remarks:Z-56756
|
|
|
|
|
|
| | N-Ethyl-N-(2-hydroxyethyl)perfluorooctylsulphonamide Basic information |
| Product Name: | N-Ethyl-N-(2-hydroxyethyl)perfluorooctylsulphonamide | | Synonyms: | N-Ethyl-N-2-hydroxyethyl perfluorooctansulfulfonamid;2-(N-ETHYLPERFLUOROOCTANESULFONAMIDO)ETHANOL;N-ethyl-1,1,2,2,3,3,4,4, 5,5,6,6,7,7,8,8,8-heptadecafluoro-N-(2-hydroxyethyl)-1-Octanesulfonamide N-Ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-(2-hydroxyethyl)-1-octanesulfonamide n-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-1-octanesulfonamid;N-ethyl-N-perfluorooctylsulfonylaminoethanol;N-Ethyl-N-(2-hydroxyethyl)-heptadecafluorooctane sulfonamide;N-Ethyl-N-(2-hydroxyethyl)perfluorooctylsulphonamideN-ethyl;N-Ethyl-N-(2-hydroxyethyl)perfluorooctylsulfonamide;N-Ethyl-Perfluoroctanesulfonamidoethanol (N-Et-FOSE alcohol) | | CAS: | 1691-99-2 | | MF: | C12H10F17NO3S | | MW: | 571.25 | | EINECS: | 216-887-4 | | Product Categories: | Organics | | Mol File: | 1691-99-2.mol |  |
| | N-Ethyl-N-(2-hydroxyethyl)perfluorooctylsulphonamide Chemical Properties |
| Melting point | 55-65°C | | Boiling point | 115-120°C | | density | 1.71 | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), DMSO, Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 14.10±0.10(Predicted) | | form | Solid | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C3H3F6NO/c4-2(5,6)1(10,11)3(7,8)9/h11H,10H2 | | InChIKey | HUFHNYZNTFSKCT-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[S](=O)(=O)N(CCO)CC | | CAS DataBase Reference | 1691-99-2(CAS DataBase Reference) | | EPA Substance Registry System | N-Ethyl-N-(2-hydroxyethyl)perfluorooctanesulfonamide (1691-99-2) |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Chronic 2
Carc. 2
Lact.
Repr. 1B
STOT RE 1 |
| | N-Ethyl-N-(2-hydroxyethyl)perfluorooctylsulphonamide Usage And Synthesis |
| Uses | N-Ethyl-N-(2-hydroxyethyl)perfluorooctylsulphonamide (Technical Grade) is a perfluorinated alkyl sulfonamide (PFAS) used in a variety of consumer products for surface protection. It is a pollutant found in the air. |
| | N-Ethyl-N-(2-hydroxyethyl)perfluorooctylsulphonamide Preparation Products And Raw materials |
|