|
|
| | 5-Carboxy-2'-deoxyuridine Basic information |
| Product Name: | 5-Carboxy-2'-deoxyuridine | | Synonyms: | Trifluridine Impurity 1（Trifluridine USP RC A）;Trifluridine USP Related Compound A;TRIFLURIDINE RELATED COMPOUND A (20 MG) (5-CARBOXY-2'-DEOXYURIDINE);5-carboxy-2'-deoxyuridine;1-(2-Deoxy-beta-D-erythro-pentofuranosyl)-1,2,3,4-tetrahydro-2,4-dioxo-5-pyrimidinecarboxylic acid;5-Carboxy-2'-dU;Trifluridine Related Compound A (10 mg) (5-Carboxy-2'-deoxyuridine);1-(2-Deoxy-β-D-erythro-pentofuranosyl)-1,2,3,4-tetrahydro-2,4-dioxo-5-pyrimidinecarboxylic acid | | CAS: | 14599-46-3 | | MF: | C10H12N2O7 | | MW: | 272.21 | | EINECS: | | | Product Categories: | Carbohydrates & Derivatives, Heterocycles, Nucleotides, Bases & Related Reagents | | Mol File: | 14599-46-3.mol |  |
| | 5-Carboxy-2'-deoxyuridine Chemical Properties |
| Melting point | >144°C (dec.) | | density | 1.711±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 5.08±0.20(Predicted) | | color | Off-White | | InChI | InChI=1/C10H12N2O7/c13-3-6-5(14)1-7(19-6)12-2-4(9(16)17)8(15)11-10(12)18/h2,5-7,13-14H,1,3H2,(H,16,17)(H,11,15,18)/t5-,6+,7+/s3 | | InChIKey | GAGYTXTVUMXAOC-QXWMLGDLNA-N | | SMILES | OC[C@H]1O[C@@H](N2C=C(C(O)=O)C(=O)NC2=O)C[C@@H]1O |&1:2,4,17,r| |
| WGK Germany | WGK 3 | | HS Code | 2934990002 | | Storage Class | 11 - Combustible Solids |
| | 5-Carboxy-2'-deoxyuridine Usage And Synthesis |
| Uses | 5-Carboxy-2'-deoxyuridine, is a derivative of Trifluridine, an anti-herpesvirus antiviral drug, used primarily on the eye. | | Uses | 5-Carboxy-2''-deoxyuridine, is a derivative of Trifluridine, an anti-herpesvirus antiviral drug, used primarily on the eye. | | Definition | ChEBI: A nucleoside analogue that is 2'-deoxyuridine in which the hydrogen at position 5 on the uracil ring is replaced by a carboxy group. |
| | 5-Carboxy-2'-deoxyuridine Preparation Products And Raw materials |
|