|
|
| | (2R,3S)-3-Phenylisoserine hydrochloride Basic information |
| Product Name: | (2R,3S)-3-Phenylisoserine hydrochloride | | Synonyms: | Docetaxel Related Compound 1 HCl;3-amino-2-hydroxy-3-phenylpropanoic acid hydrochloride;(2R,3S)-3-Phenylisoserine hydrochloride Paclitaxel int;(2R,3S)-3-Amino-2-hydroxy-3-phenyl-propanoic acid hydrochloride;(2r,3s)-3-phenylisoserine hydrochloride;(2R,3S)-3-phenylisoserine Hydrochloride ( Paclitaxel side chain);(2R,3S)-3-PHENYLISOSERINE HYDROCHLORIDE,98+%;3-(2R,3S)-PHENYLISOSERINE HCL | | CAS: | 132201-32-2 | | MF: | C9H12ClNO3 | | MW: | 217.65 | | EINECS: | 603-555-2 | | Product Categories: | | | Mol File: | 132201-32-2.mol |  |
| | (2R,3S)-3-Phenylisoserine hydrochloride Chemical Properties |
| Melting point | 222-224°C (dec.) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder | | color | White | | InChI | InChI=1/C9H11NO3.ClH/c10-7(8(11)9(12)13)6-4-2-1-3-5-6;/h1-5,7-8,11H,10H2,(H,12,13);1H/t7-,8+;/s3 | | InChIKey | OTJZSGZNPDLQAJ-GIFZIGMNNA-N | | SMILES | [C@@H](O)([C@@H](N)C1C=CC=CC=1)C(O)=O.Cl |&1:0,2,r| | | CAS DataBase Reference | 132201-32-2(CAS DataBase Reference) |
| | (2R,3S)-3-Phenylisoserine hydrochloride Usage And Synthesis |
| Uses | (2R,3S)-3-Phenylisoserine Hydrochloride is used in the synthetic preparation of the catalytic asymmetric synthesis of both syn- and anti-β-amino alcohols. (2R,3S)-3-Phenylisoserine Hydrochloride is also used for the synthesis of N-benzoylphenylisoserinates of Lactarius sesquiterpenoid alcohols and is responsible for their antifeedant properties against storage pests. |
| | (2R,3S)-3-Phenylisoserine hydrochloride Preparation Products And Raw materials |
|