| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Accela ChemBio Inc. |
| Tel: |
+1-858-6993322 +86-18019713315 |
| Email: |
info@accelachem.com |
|
| | Diethyl (difluoro(trimethylsilyl)methyl) -phosphonate, 96 Basic information |
| Product Name: | Diethyl (difluoro(trimethylsilyl)methyl) -phosphonate, 96 | | Synonyms: | diethyl(difluoro(trimethylsilyl)methyl)-phosphon;Diethyl [difluoro(trimethylsilyl)methyl]phosphonate;[Diethoxyphosphoryl(difluoro)methyl]-trimethyl-silane;Phosphonic acid, P-[difluoro(trimethylsilyl)methyl]-, diethyl ester;Diethyl (difluoro(trimethylsilyl)methyl) -phosphonate, 96 | | CAS: | 80077-72-1 | | MF: | C8H19F2O3PSi | | MW: | 260.29 | | EINECS: | | | Product Categories: | | | Mol File: | 80077-72-1.mol |  |
| | Diethyl (difluoro(trimethylsilyl)methyl) -phosphonate, 96 Chemical Properties |
| Boiling point | 75 °C0.2 mm Hg(lit.) | | density | 1.077 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.414(lit.) | | Fp | 110 °F | | form | liquid | | InChI | 1S/C8H19F2O3PSi/c1-6-12-14(11,13-7-2)8(9,10)15(3,4)5/h6-7H2,1-5H3 | | InChIKey | AUYUSSHVQGGCCS-UHFFFAOYSA-N | | SMILES | CCOP(=O)(OCC)C(F)(F)[Si](C)(C)C |
| Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 10 - Combustible liquids |
| | Diethyl (difluoro(trimethylsilyl)methyl) -phosphonate, 96 Usage And Synthesis |
| | Diethyl (difluoro(trimethylsilyl)methyl) -phosphonate, 96 Preparation Products And Raw materials |
|