|
|
| | OLPRINONE HYDROCHLORIDE Basic information |
| Product Name: | OLPRINONE HYDROCHLORIDE | | Synonyms: | Olprinone hydrochloride - Loprinone hydrochloride;3-pyridinecarbonitrile,1,2-dihydro-5-(imidazo(1,2-a)pyridin-6-yl)-6-methyl-2-o;e1020;xo-,monohydrochloride,monohydrate;OLPRINONE HCL;1,2-Dihydro-5-imidazo[1,2-α]pyridin-6-yl-6-methyl-2-oxo-3-pyridinecarbonitrile Hydrochloride;Coretec;Loprinone hydrochloride, 1,2-Dihydro-5-(imidazo[1,2-a]pyridin-6-yl)-6-methyl-2-oxo-3-pyridinecarbonitrile hydrochloride | | CAS: | 119615-63-3 | | MF: | C14H11ClN4O | | MW: | 286.72 | | EINECS: | | | Product Categories: | Heterocyclic Compounds;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 119615-63-3.mol |  |
| | OLPRINONE HYDROCHLORIDE Chemical Properties |
| Melting point | >3000C | | storage temp. | 2-8°C | | solubility | DMSO: ≤4 mg/mL | | form | solid | | color | beige | | InChI | InChI=1S/C14H10N4O.ClH/c1-9-12(6-11(7-15)14(19)17-9)10-2-3-13-16-4-5-18(13)8-10;/h2-6,8H,1H3,(H,17,19);1H | | InChIKey | PWTBMBAQRAOAFF-UHFFFAOYSA-N | | SMILES | CC1NC(=O)C(C#N)=CC=1C1C=CC2=NC=CN2C=1.Cl |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | US4201450 |
| | OLPRINONE HYDROCHLORIDE Usage And Synthesis |
| Description | Coatec was launched in Japan for acute cardiac insufficiency in cases
resistant to other treatments. There are three related synthetic routes, 5-6 steps
each, to loprinone all converging on 1-(imidazo[1,2a]pyridyl-6-yl)-Zpropanone as an
advanced intermediate. It is a potent and selective inhibitor of PDE Ⅲ and a long
lasting, orally active, positive inotropic agent. The PDE Ⅲ inhibition caused
increased levels of CAMP which leads to the positive inotropic effect that was not
altered by β or H2-preceptor antagonists. It was 100 times less potent at PDE I and
PDE Ⅱ with no Na-K-ATPase activity. Improved hemodynamic parameters with slight
changes in heart rate and blood pressure were seen in vivo. It is not mutagenic and
its primary metabolite was less active. | | Chemical Properties | Off-White Crystalline Powder | | Originator | Eisai (Japan) | | Uses | Inotropic agent which inhibits cAMP phosphodiesterase. Cardiotonic. | | Definition | ChEBI: Olprinone hydrochloride is an organic molecular entity. | | Brand name | Coatec |
| | OLPRINONE HYDROCHLORIDE Preparation Products And Raw materials |
|