|
|
| | 1-(tert-Butyldimethylsilyloxy)-1-methoxyethene Basic information |
| | 1-(tert-Butyldimethylsilyloxy)-1-methoxyethene Chemical Properties |
| Melting point | 74-76 °C | | Boiling point | 62 °C/9 mmHg (lit.) | | density | 0.863 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.429(lit.) | | Fp | 125 °F | | storage temp. | Room Temperature (Recommended in a cool and dark place, <15°C) | | form | clear liquid | | Specific Gravity | 0.87 | | color | Colorless to Almost colorless | | InChI | InChI=1S/C9H20O2Si/c1-8(10-5)11-12(6,7)9(2,3)4/h1H2,2-7H3 | | InChIKey | UVCCWXJGWMGZAB-UHFFFAOYSA-N | | SMILES | [Si](C(C)(C)C)(OC(OC)=C)(C)C |
| Risk Statements | 10 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3 | | HS Code | 2931900090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | 1-(tert-Butyldimethylsilyloxy)-1-methoxyethene Usage And Synthesis |
| Uses | 1-(tert-Butyldimethylsilyloxy)-1-methoxyethene can be used for synthesis of β-hydroxy esters, indolyl-β3, 3-aminoacid esters and nitroso acetals etc.
| | General Description | 1-(tert-Butyldimethylsilyloxy)-1-methoxyethene is an organosilicon compound , which reacts with 2,4'-Dibromoacetophenone to form methyl 4-(4-bromophenyl)-4-oxobutanoate. |
| | 1-(tert-Butyldimethylsilyloxy)-1-methoxyethene Preparation Products And Raw materials |
|