|
|
| | Uridine-13C9-15N2 5'-(tetrahydrogen triphosphate) sodium salt Basic information |
| Product Name: | Uridine-13C9-15N2 5'-(tetrahydrogen triphosphate) sodium salt | | Synonyms: | UTP.Na2;5′-UTP,2Na;uridine-13c9,15n2 5-triphosphate disodium salt;Uridine-13C9-15N2 5'-(tetrahydrogen triphosphate) sodium salt;Sodium ((2R,3S,4R,5R)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl dihydrogentriphosphate;Uridine-13C9-15N25'-(tetrahydrogen triphosphate);Uridine-13C9-15N25'-(tetrahydrogen triphosphate), sodium salt;URIDINE-13C9, 15N2-5 TRIPHOSPHATE SODI U | | CAS: | 285978-18-9 | | MF: | C9H13N2O15P3.2Na | | MW: | 528.103 | | EINECS: | 2017-001-1 | | Product Categories: | Material;Pharmaceutical | | Mol File: | 285978-18-9.mol |  |
| | Uridine-13C9-15N2 5'-(tetrahydrogen triphosphate) sodium salt Chemical Properties |
| Melting point | >199C (dec.) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Water (Slightly) | | form | Solid | | color | White to Off-White | | Water Solubility | Water : 125 mg/mL (231.90 mM; Need ultrasonic) | | Stability: | Hygroscopic | | InChIKey | JFXKPFPIFSFLOU-RFFBCSJBNA-L | | SMILES | [C@@H]1([C@H](O)[C@H](O)[C@@H](COP([O-])(=O)OP(O)(=O)OP([O-])(=O)O)O1)N1C=CC(=O)NC1=O.[Na+].[Na+] |&1:0,1,3,5,r| |
| | Uridine-13C9-15N2 5'-(tetrahydrogen triphosphate) sodium salt Usage And Synthesis |
| Uses | Uridine 5’-Triphosphate-13C9,15N2 Sodium Salt is the labelled form of the nucleotide UTP (CAS# 63-39-8) used for diagnosis of stenoses and other conditions of restricted blood flow. | | Reactions | Uridine-13C9-15N2 5'-(tetrahydrogen triphosphate) sodium salt can be used in
nucleic acid synthesis. |
| | Uridine-13C9-15N2 5'-(tetrahydrogen triphosphate) sodium salt Preparation Products And Raw materials |
|