|
|
| | Isopropylphenyl phosphate Basic information |
| Product Name: | Isopropylphenyl phosphate | | Synonyms: | Phenol,isopropylated,phosphate(3:1);TRIS(ISOPROPYLPHENYL)PHOSPHATE-1M ALKYL;isopropylated phenol phosphate;ISOPROPYLATED TRIPHENYL PHOSPHATE;Isopropylphenyl phosphate;triisopropylated phenyl phosphate;Phenolphosphateisopropylated;Triarylphosphatisopropylated | | CAS: | 68937-41-7 | | MF: | C27H33O4P | | MW: | 452.52 | | EINECS: | 273-066-3 | | Product Categories: | Flame retardant;fire retardant | | Mol File: | 68937-41-7.mol |  |
| | Isopropylphenyl phosphate Chemical Properties |
| Boiling point | 400℃[at 101 325 Pa] | | density | 1.168[at 20℃] | | vapor pressure | 0Pa at 25℃ | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Benzene (Slightly), Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Water Solubility | 330μg/L at 20℃ | | Stability: | Hygroscopic, Moisture Sensitive | | InChI | InChI=1S/C27H33O4P/c1-19(2)22-7-13-25(14-8-22)29-32(28,30-26-15-9-23(10-16-26)20(3)4)31-27-17-11-24(12-18-27)21(5)6/h7-21H,1-6H3 | | InChIKey | ANVREEJNGJMLOV-UHFFFAOYSA-N | | SMILES | P(OC1=CC=C(C(C)C)C=C1)(OC1=CC=C(C(C)C)C=C1)(OC1=CC=C(C(C)C)C=C1)=O | | LogP | 4.92 at 25℃ | | CAS DataBase Reference | 68937-41-7(CAS DataBase Reference) | | EPA Substance Registry System | Isopropylated phenol phosphate (3:1) (68937-41-7) |
| | Isopropylphenyl phosphate Usage And Synthesis |
| Characteristics |
Isopropylphenyl phosphate is low viscosity, low toxicity, odourless and non-polluting.
| | Uses | Isopropylphenyl phosphate, is a flame retardant. | | Application |
Isopropylphenyl phosphate is commonly used as a plasticising, lubricating, toughening and flame retardant additive in industrial applications.
|
| | Isopropylphenyl phosphate Preparation Products And Raw materials |
|