4,4',4''-(benzene-1,3,5-triyltris(ethyne-2,1-diyl))tribenzaldehyde manufacturers
|
| | 4,4',4''-(benzene-1,3,5-triyltris(ethyne-2,1-diyl))tribenzaldehyde Basic information |
| Product Name: | 4,4',4''-(benzene-1,3,5-triyltris(ethyne-2,1-diyl))tribenzaldehyde | | Synonyms: | 4,4',4''-(benzene-1,3,5-triyltris(ethyne-2,1-diyl))tribenzaldehyde;4,4',4''-(benzene-1,3,5-triyltris(ethene-2,1-diyl))tribenzaldehyde | | CAS: | 2289758-98-9 | | MF: | C33H18O3 | | MW: | 462.49 | | EINECS: | | | Product Categories: | | | Mol File: | 2289758-98-9.mol |  |
| | 4,4',4''-(benzene-1,3,5-triyltris(ethyne-2,1-diyl))tribenzaldehyde Chemical Properties |
| Boiling point | 734.7±60.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C33H18O3/c34-22-28-10-1-25(2-11-28)7-16-31-19-32(17-8-26-3-12-29(23-35)13-4-26)21-33(20-31)18-9-27-5-14-30(24-36)15-6-27/h1-6,10-15,19-24H | | InChIKey | RSQZINMBNWLMKM-UHFFFAOYSA-N | | SMILES | C1(C#CC2=CC=C(C=C2)C=O)=CC(C#CC2=CC=C(C=C2)C=O)=CC(C#CC2=CC=C(C=C2)C=O)=C1 |
| | 4,4',4''-(benzene-1,3,5-triyltris(ethyne-2,1-diyl))tribenzaldehyde Usage And Synthesis |
| Uses | Used as a monomer for the synthesis of COF materials. |
| | 4,4',4''-(benzene-1,3,5-triyltris(ethyne-2,1-diyl))tribenzaldehyde Preparation Products And Raw materials |
|