| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Danshensu sodium salt CAS:81075-52-7 Purity:>=98% (HPLC) Package:5MG Remarks:SML0679-5MG
|
| Company Name: |
Target molecule Corp.
|
| Tel: |
857-239-0968 |
| Email: |
service1@targetmol.com |
| Products Intro: |
Product Name:Sodium Danshensu CAS:81075-52-7 Purity:98% Package:10mg;50mg;200mg;;;
|
| Company Name: |
Shanghai Beiwanta Biotechnology Co., Ltd.
|
| Tel: |
021-67187366 19901745723 |
| Email: |
info@bwtlab.com |
| Products Intro: |
Product Name:13C6]-Danshensu sodium salt CAS:81075-52-7 Purity:95+ Package:1mg;5mg;10mg;20mg
|
| Company Name: |
SHAANXI?DIDEU?MEDICHEM CO.LTD
|
| Tel: |
17691182729; 17392216275 |
| Email: |
1102@dideu.com |
| Products Intro: |
Product Name:Sodium Danshensu CAS:81075-52-7 Purity:98% Package:25KG
|
|
| | Danshensu Sodium Salt Basic information |
| Product Name: | Danshensu Sodium Salt | | Synonyms: | Danshensu Sodium Salt;Sodium Dahshensu;(R)-(+)-3-(3,4-Dihydroxyphenyl)lactic acid;(R)-α,3,4-Trihydroxy-benzenepropanoic acid sodium salt;3-(3′,4′-Dihydroxyphenyl)-(2R)-lactic acid sodium salt;DS 182;Salianic acid A;(R)-Sodium Danshensu | | CAS: | 81075-52-7 | | MF: | C9H11NaO5 | | MW: | 222.17 | | EINECS: | | | Product Categories: | | | Mol File: | 81075-52-7.mol |  |
| | Danshensu Sodium Salt Chemical Properties |
| Melting point | >230°C (dec.) | | storage temp. | 2-8°C | | solubility | H2O: soluble20mg/mL, clear | | form | powder | | color | white to beige | | Optical Rotation | [α]/D +30 to +40°, c = 1 in H2O | | Water Solubility | H2O: 20mg/mL, clear | | Stability: | Hygroscopic | | InChI | 1S/C9H10O5.Na/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14;/h1-3,8,10-12H,4H2,(H,13,14);/q;+1/p-1/t8-;/m1./s1 | | InChIKey | ZMMKVDBZTXUHFO-DDWIOCJRSA-M | | SMILES | OC1=C(O)C=CC(C[C@@H](O)C([O-])=O)=C1.[Na+] |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Danshensu Sodium Salt Usage And Synthesis |
| Uses | Sodium Danshensu is exhibits protective effects on the excitotoxicity of monosodium glutamate in the late stage of pregnancy on developing mouse fetal brain. | | Biochem/physiol Actions | Danshensu is an active component of Salvia miltiorrhiza (Danshen) that suppresses the formation of reactive oxygen species, inhibits platelet adhesion and aggregation, and protects myocardium against ischemia. Danshensu is cardioprotective, which protects myocardium from the reperfusion injury and inhibits apoptosis of H9c2 cardiomyocytes via Akt and ERK1/2 phosphorylation. | | in vivo | Danshensu (Dan shen suan A; 25, 50, 100mg/kg; oral administration daily for 7 continuous days or i.v. once) sodium before SARS-CoV-2 S infection dose-dependently alleviates the pathological alterations in mice infected with SARS-CoV-2 S[1].
| Animal Model: | Adult BALB/c mice (male, 6-8 weeks, 20±2g)[1] | | Dosage: | 25, 50, 100mg/kg | | Administration: | Oral administration (daily for 7 continuous days) or i.v. (once) | | Result: | Could prevent SARS-CoV-2 S protein-induced acute lung inflammation.
Ameliorated inflammatory cytokines in serum and lung tissue.
|
|
| | Danshensu Sodium Salt Preparation Products And Raw materials |
|