| Company Name: |
Alchem Pharmtech,Inc. |
| Tel: |
8485655694 |
| Email: |
sales@alchempharmtech.com |
| Products Intro: |
Product Name:(2S,3S,5S,8R,9S,10S,13S,14S,16S,17R)-10,13-Dimethyl-2,16-di(piperidin-1-yl)hexadecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol
CAS:13522-16-2
Purity:97+% Package:1g;10g;100g;;1kg Remarks:Z-33934
|
|
|
|
|
|
| | 2,16-Dipiperidin-1-ylandrosta-3,17-diol Basic information |
| Product Name: | 2,16-Dipiperidin-1-ylandrosta-3,17-diol | | Synonyms: | Vecuronium intermediate 6;(2β,3α,5α,16β,17β)-2,16-Di-1-piperidinyl-androstane-3,
17-diol;Androstane-3,17-diol, 2,16-di-1-piperidinyl-,(2,3,5,16,17)-(9CI);(2beta,3alpha,5alpha,16beta,17beta)-2,16-dipiperidin-1-ylandrosta-3,17 diol;2,16-DIPIPERIDIN-1-YL-ANDROSTA-3,17-DIOL;2-(1-Piperidinyl)-16-(1-piperidinyl)-5-androstane-3,17-diol;2β,16β-Di(1-piperidinyl)-5α-androstane-3α,17β-diol;(2β,3α,5α,16β,17β)-2,16-dipiperidin-1-ylandrosta-3,17 diol | | CAS: | 13522-16-2 | | MF: | C29H50N2O2 | | MW: | 458.72 | | EINECS: | 236-866-3 | | Product Categories: | Intermediates | | Mol File: | 13522-16-2.mol |  |
| | 2,16-Dipiperidin-1-ylandrosta-3,17-diol Chemical Properties |
| Melting point | 157 °C | | Boiling point | 571.1±50.0 °C(Predicted) | | density | 1.117±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.91±0.70(Predicted) | | InChIKey | SMEIBKQQBOLIMJ-MRKRSBMYNA-N | | SMILES | [C@]12(C)CC[C@]3([C@@]([H])(CC[C@@]4([H])C[C@H](O)[C@@H](N5CCCCC5)C[C@]34C)[C@]1([H])C[C@H](N1CCCCC1)[C@@H]2O)[H] |&1:0,4,5,9,12,14,22,24,27,34,r| |
| | 2,16-Dipiperidin-1-ylandrosta-3,17-diol Usage And Synthesis |
| Uses | 2β,16β-Dipiperidino-5α-androstane-3α,17β-diol is used in the synthesis of Pancuronium bromide (P178500). |
| | 2,16-Dipiperidin-1-ylandrosta-3,17-diol Preparation Products And Raw materials |
|