|
|
| | Eldecalcitol Impurity 3 Basic information |
| Product Name: | Eldecalcitol Impurity 3 | | Synonyms: | Eldecalcitol Impurity 3;(1R,2R,3R)-5-((Z)-2-((1R,7aR)-1-((R)-6-hydroxy-6-methylheptan-2-yl)-7a-methyl-2,3,3a,6,7,7a-hexahydro-1H-inden-4-yl)vinyl)-2-(3-hydroxypropoxy)-4-methylcyclohex-4-ene-1,3-diol;9,10-Secocholesta-5(10),6,8-triene-1,3,25-triol, 2-(3-hydroxypropoxy)-, (1α,2β,3β,6Z)- (9CI);(1R,2R,3R)-5-((Z)-2-((1R,3aR,7aR)-1-((R)-6-Hydroxy-6-methylheptan-2-yl)-7a-methyl-2,3,3a,6,7,7a-hexahydro-1H-inden-4-yl)vinyl)-2-(3-hydroxypropoxy)-4-methylcyclohex-4-ene-1,3-diol;Pre ED-71 | | CAS: | 201854-22-0 | | MF: | C30H50O5 | | MW: | 490.72 | | EINECS: | | | Product Categories: | | | Mol File: | 201854-22-0.mol |  |
| | Eldecalcitol Impurity 3 Chemical Properties |
| Boiling point | 655.2±55.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | pka | 13.62±0.70(Predicted) | | InChIKey | KXLYTOWHSZWHSQ-MZBQCLPSNA-N | | SMILES | C[C@]12CCC=C(/C=C\C3C[C@@H](O)[C@@H](OCCCO)[C@H](O)C=3C)[C@]1([H])CC[C@]2([H])[C@H](C)CCCC(O)(C)C |&1:1,10,12,18,22,26,28,r| |
| | Eldecalcitol Impurity 3 Usage And Synthesis |
| Uses | Eldecalcitol is a derivative of vitamin D3 (V676045) which is the vitamin that mediates intestinal calcium absorbtion, bone calcium metabolism and probably, muscle activity. |
| | Eldecalcitol Impurity 3 Preparation Products And Raw materials |
|