| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | 2(5H)-Furanone, 4-propyl- Basic information |
| Product Name: | 2(5H)-Furanone, 4-propyl- | | Synonyms: | 2(5H)-Furanone, 4-propyl-;4-propyl-5H-furan-2-one;3-propyl-2H-furan-5-one;4-n-propylfuran-2 (5H) - one;4-Propylfuran-2(5H)-one | | CAS: | 21963-27-9 | | MF: | C7H10O2 | | MW: | 126.15 | | EINECS: | | | Product Categories: | | | Mol File: | 21963-27-9.mol |  |
| | 2(5H)-Furanone, 4-propyl- Chemical Properties |
| Boiling point | 103-105 °C(Press: 1 Torr) | | density | 1.037±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C7H10O2/c1-2-3-6-4-7(8)9-5-6/h4H,2-3,5H2,1H3 | | InChIKey | KSUAOJBVUIYHSM-UHFFFAOYSA-N | | SMILES | O1CC(CCC)=CC1=O |
| | 2(5H)-Furanone, 4-propyl- Usage And Synthesis |
| | 2(5H)-Furanone, 4-propyl- Preparation Products And Raw materials |
|