|
|
| | Isoeleutherin Basic information |
| Product Name: | Isoeleutherin | | Synonyms: | 1H-Naphtho[2,3-c]pyran-5,10-dione, 3,4-dihydro-9-methoxy-1,3-dimethyl-, (1S,3S)-;(1S,3S)-9-Methoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione | | CAS: | 1078723-14-4 | | MF: | C16H16O4 | | MW: | 272.3 | | EINECS: | | | Product Categories: | | | Mol File: | 1078723-14-4.mol |  |
| | Isoeleutherin Chemical Properties |
| Melting point | 168-170 °C | | Boiling point | 465.3±45.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | form | Solid | | color | Yellow to orange | | InChI | InChI=1S/C16H16O4/c1-8-7-11-13(9(2)20-8)16(18)14-10(15(11)17)5-4-6-12(14)19-3/h4-6,8-9H,7H2,1-3H3/t8-,9-/m0/s1 | | InChIKey | IAJIIJBMBCZPSW-IUCAKERBSA-N | | SMILES | [C@@H]1(C)O[C@@H](C)CC2C(=O)C3=C(C(=O)C1=2)C(OC)=CC=C3 |
| | Isoeleutherin Usage And Synthesis |
| Uses | Isoeleutherin is a naphthopyran derivative isolated from E. americana Merr. Et Heyne with anti-fungal, anti-viral, and anti-tumor activities. Isoeleutherin plays an important role in selective modulation of T helper cell-mediated immune responses[1]. | | References | [1] Francesca R Gallo, et al. Polyketides from Eleutherine bulbosa. Nat Prod Res. 2010 Oct;24(16):1578-86. DOI:10.1080/14786419.2010.500007 |
| | Isoeleutherin Preparation Products And Raw materials |
|