|
|
| | Cyclopropanamine, 2-(2,3-difluorophenyl)-, (1R,2S)- Basic information |
| Product Name: | Cyclopropanamine, 2-(2,3-difluorophenyl)-, (1R,2S)- | | Synonyms: | Cyclopropanamine, 2-(2,3-difluorophenyl)-, (1R,2S)-;(1R,2S)-2-(2,3-Difluorophenyl)cyclopropylamine;(1R,2S)-2-(2,3-difluorophenyl)cyclopropan-1-amine;(1R,2S)-2-(2,3-Difluorophenyl)cyclopropanamine | | CAS: | 1427524-53-5 | | MF: | C9H9F2N | | MW: | 169.17 | | EINECS: | | | Product Categories: | | | Mol File: | 1427524-53-5.mol |  |
| | Cyclopropanamine, 2-(2,3-difluorophenyl)-, (1R,2S)- Chemical Properties |
| Boiling point | 195.1±40.0 °C(Predicted) | | density | 1.268±0.06 g/cm3(Predicted) | | pka | 8.05±0.20(Predicted) | | InChI | InChI=1S/C9H9F2N/c10-7-3-1-2-5(9(7)11)6-4-8(6)12/h1-3,6,8H,4,12H2/t6-,8+/m0/s1 | | InChIKey | MCABSRDMAUTFDE-POYBYMJQSA-N | | SMILES | [C@@H]1(N)C[C@H]1C1=CC=CC(F)=C1F |
| | Cyclopropanamine, 2-(2,3-difluorophenyl)-, (1R,2S)- Usage And Synthesis |
| Uses | (1R,2S)-2-(2,3-dDifluorophenyl)cyclopropanamine D-Mandelic Acid, is used in the synthesis of Ticagrelor (T437700), which is the first reversible oral P2Y12 receptor antagonist, provides faster, greater, and more consistent ADP-receptor inhibition than Clopidogrel. Used in the treatment of acute coronary syndromes (ACS). |
| | Cyclopropanamine, 2-(2,3-difluorophenyl)-, (1R,2S)- Preparation Products And Raw materials |
|