Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
Tel: |
021-64609169 18901607656 |
Email: |
greensnown@163.com |
Products Intro: |
Product Name:Oseltamivir Impurity 37 CAS:91950-41-3 Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
|
| Benzenesulfonic acid, 1,1-dimethylethyl ester Basic information |
| Benzenesulfonic acid, 1,1-dimethylethyl ester Chemical Properties |
Boiling point | 300.7±11.0 °C(Predicted) | density | 1.145±0.06 g/cm3(Predicted) | InChI | InChI=1S/C10H14O3S/c1-10(2,3)13-14(11,12)9-7-5-4-6-8-9/h4-8H,1-3H3 | InChIKey | WDFTWKQHSSVVJK-UHFFFAOYSA-N | SMILES | C1(S(OC(C)(C)C)(=O)=O)=CC=CC=C1 |
| Benzenesulfonic acid, 1,1-dimethylethyl ester Usage And Synthesis |
| Benzenesulfonic acid, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|