|
|
| | Benzenesulfonic acid, 1,1-dimethylethyl ester Basic information |
| Product Name: | Benzenesulfonic acid, 1,1-dimethylethyl ester | | Synonyms: | Benzenesulfonic acid, 1,1-dimethylethyl ester;Atracurium Impurity 43;tert-Butyl Benzenesulfonate;1,1-Dimethylethyl benzenesulfonate;Atracurium Besylate Impurity 43;Benzenesulfonic acid tert-butyl ester | | CAS: | 91950-41-3 | | MF: | C10H14O3S | | MW: | 214.28 | | EINECS: | | | Product Categories: | | | Mol File: | 91950-41-3.mol |  |
| | Benzenesulfonic acid, 1,1-dimethylethyl ester Chemical Properties |
| Boiling point | 300.7±11.0 °C(Predicted) | | density | 1.145±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C10H14O3S/c1-10(2,3)13-14(11,12)9-7-5-4-6-8-9/h4-8H,1-3H3 | | InChIKey | WDFTWKQHSSVVJK-UHFFFAOYSA-N | | SMILES | C1(S(OC(C)(C)C)(=O)=O)=CC=CC=C1 |
| | Benzenesulfonic acid, 1,1-dimethylethyl ester Usage And Synthesis |
| | Benzenesulfonic acid, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|