|
|
| | 1,4-Piperidinedicarboxylic acid, 3-phenyl-, 1-(1,1-dimethylethyl) ester, (3S,4R)- Basic information |
| Product Name: | 1,4-Piperidinedicarboxylic acid, 3-phenyl-, 1-(1,1-dimethylethyl) ester, (3S,4R)- | | Synonyms: | 1,4-Piperidinedicarboxylic acid, 3-phenyl-, 1-(1,1-dimethylethyl) ester, (3S,4R)-;(3S,4R)-1-Boc-3-phenylpiperidine-4-carboxylic Acid | | CAS: | 951742-83-9 | | MF: | C17H23NO4 | | MW: | 305.37 | | EINECS: | | | Product Categories: | | | Mol File: | 951742-83-9.mol |  |
| | 1,4-Piperidinedicarboxylic acid, 3-phenyl-, 1-(1,1-dimethylethyl) ester, (3S,4R)- Chemical Properties |
| form | solid | | InChI | 1S/C17H23NO4/c1-17(2,3)22-16(21)18-10-9-13(15(19)20)14(11-18)12-7-5-4-6-8-12/h4-8,13-14H,9-11H2,1-3H3,(H,19,20)/t13-,14-/m1/s1 | | InChIKey | KHCTXOGRWQLHBK-ZIAGYGMSSA-N | | SMILES | O=C(O)[C@H]1[C@@H](C2=CC=CC=C2)CN(C(OC(C)(C)C)=O)CC1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 1,4-Piperidinedicarboxylic acid, 3-phenyl-, 1-(1,1-dimethylethyl) ester, (3S,4R)- Usage And Synthesis |
| | 1,4-Piperidinedicarboxylic acid, 3-phenyl-, 1-(1,1-dimethylethyl) ester, (3S,4R)- Preparation Products And Raw materials |
|