|
|
| | Wortoxetine Impurity T: Acetyl Wortoxetine Basic information |
| Product Name: | Wortoxetine Impurity T: Acetyl Wortoxetine | | Synonyms: | Ethanone, 1-[4-[2-[(2,4-dimethylphenyl)thio]phenyl]-1-piperazinyl]-;N-acetyl vortioxetine IMPURITY;N,N-bis(2-bromophenyl)nitrous amide;N-nitroso-dixylylamine;Vortioxetine Impurity 102;Vortioxetine Impurity 62 | | CAS: | 1801352-86-2 | | MF: | C20H24N2OS | | MW: | 340.48 | | EINECS: | | | Product Categories: | | | Mol File: | 1801352-86-2.mol |  |
| | Wortoxetine Impurity T: Acetyl Wortoxetine Chemical Properties |
| Boiling point | 491.7±45.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | pka | 2.31±0.10(Predicted) | | InChI | InChI=1S/C20H24N2OS/c1-15-8-9-19(16(2)14-15)24-20-7-5-4-6-18(20)22-12-10-21(11-13-22)17(3)23/h4-9,14H,10-13H2,1-3H3 | | InChIKey | RTOYXVAUQYVQHB-UHFFFAOYSA-N | | SMILES | C(=O)(N1CCN(C2=CC=CC=C2SC2=CC=C(C)C=C2C)CC1)C |
| | Wortoxetine Impurity T: Acetyl Wortoxetine Usage And Synthesis |
| Uses | 1-[4-[2-[(2,4-Dimethylphenyl)thio]phenyl]-1-piperazinyl]ethanone is a useful chemical reagent. It is an impurity of Vortioxetine which is a multimodal serotonergic agent that inhibits 5-HT1A, 5-HT1B, 5-HT3A, 5-HT7 receptor and SERT (1,2,3). |
| | Wortoxetine Impurity T: Acetyl Wortoxetine Preparation Products And Raw materials |
|