| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
Specs |
| Tel: |
+31 15 251 8111 |
| Email: |
info@specs.net |
|
| | 2-(2,4-Dimethylphenyl)-1,3-dioxoisoindoline-5-carboxylic acid Basic information |
| | 2-(2,4-Dimethylphenyl)-1,3-dioxoisoindoline-5-carboxylic acid Chemical Properties |
| form | solid | | InChI | 1S/C17H13NO4/c1-9-3-6-14(10(2)7-9)18-15(19)12-5-4-11(17(21)22)8-13(12)16(18)20/h3-8H,1-2H3,(H,21,22) | | InChIKey | QXQRWKQVBVSIKE-UHFFFAOYSA-N | | SMILES | N2(C(=O)c3c(ccc(c3)C(=O)O)C2=O)c1c(cc(cc1)C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-(2,4-Dimethylphenyl)-1,3-dioxoisoindoline-5-carboxylic acid Usage And Synthesis |
| | 2-(2,4-Dimethylphenyl)-1,3-dioxoisoindoline-5-carboxylic acid Preparation Products And Raw materials |
|