9-FLUORENONE-1-CARBOXYLIC ACID manufacturers
|
| | 9-FLUORENONE-1-CARBOXYLIC ACID Basic information |
| Product Name: | 9-FLUORENONE-1-CARBOXYLIC ACID | | Synonyms: | 9-FLUORENONE-1-CARBOXYLIC ACID;9-OXO-1-FLUORENECARBOXYLIC ACID;9-oxo-9H-fluorenecarboxylic acid;9-Oxofluorene-1-carboxylic acid;9-oxo-9H-fluorene-1-carboxylic acid;9-Fluorenone-1-carboxylic acid,9-Oxo-1-fluorenecarboxylic acid;9-Fluorenone-1-carboxylic acid 99%;9-Fluorenone-1-carboxylic acid,98% | | CAS: | 1573-92-8 | | MF: | C14H8O3 | | MW: | 224.21 | | EINECS: | 216-396-5 | | Product Categories: | Fluorenes & Fluorenones;Fluorenones | | Mol File: | 1573-92-8.mol |  |
| | 9-FLUORENONE-1-CARBOXYLIC ACID Chemical Properties |
| Melting point | 196-198 °C (lit.) | | Boiling point | 461.6±24.0 °C(Predicted) | | density | 1.424±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Methanol | | form | Solid | | pka | 3.48±0.20(Predicted) | | color | Brown | | InChI | 1S/C14H8O3/c15-13-10-5-2-1-4-8(10)9-6-3-7-11(12(9)13)14(16)17/h1-7H,(H,16,17) | | InChIKey | CBEFMGJHEKAMNI-UHFFFAOYSA-N | | SMILES | OC(=O)c1cccc2-c3ccccc3C(=O)c12 | | CAS DataBase Reference | 1573-92-8(CAS DataBase Reference) |
| | 9-FLUORENONE-1-CARBOXYLIC ACID Usage And Synthesis |
| Chemical Properties | orange crystalline powder | | Uses | 9-Fluorenone-1-carboxylic Acid is an intermediate in synthesizing Fluoren-1-ol (F462450), a metabolite of the PAH micropollutant Fluorene (F462002) with potential mutagenic effects. It is used as biomarkers to evaluate exposure to PAHs and environmental tobacco smoke in general population. | | Uses | 9-Fluorenone-1-carboxylic acid was used in preparation of (E)- and (Z)-isomers of twisted 1,1′-dibromobifluorenylidene. | | General Description | 9-Fluorenone-1-carboxylic acid is formed as an intermediate during four-ring polycyclic aromatic hydrocarbon fluoranthene degradation by Pseudomonas alcaligenes strain PA-10. |
| | 9-FLUORENONE-1-CARBOXYLIC ACID Preparation Products And Raw materials |
|