|
|
| | 4-Fluoro-1-methoxy-2-methylbenzene Basic information |
| | 4-Fluoro-1-methoxy-2-methylbenzene Chemical Properties |
| Boiling point | 69-70°C 4mm | | density | 1.0867 (estimate) | | refractive index | 1.4915-1.4935 | | Fp | 69-70°C/4mm | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Colorless to light yellow Liquid | | BRN | 2517140 | | InChI | InChI=1S/C8H9FO/c1-6-5-7(9)3-4-8(6)10-2/h3-5H,1-2H3 | | InChIKey | QXOBYWRKNIDHJG-UHFFFAOYSA-N | | SMILES | C1(OC)=CC=C(F)C=C1C | | CAS DataBase Reference | 399-54-2(CAS DataBase Reference) |
| Hazard Codes | Xi,F | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | Hazard Note | Flammable/Irritant | | HazardClass | IRRITANT | | HS Code | 29093090 |
| | 4-Fluoro-1-methoxy-2-methylbenzene Usage And Synthesis |
| Chemical Properties | clear colorless liquid |
| | 4-Fluoro-1-methoxy-2-methylbenzene Preparation Products And Raw materials |
|