|
|
| | Ketoketal Basic information |
| Product Name: | Ketoketal | | Synonyms: | 4-{1,4-dioxaspiro[4.5]decan-8-yl}cyclohexan-1-one;bicyclohexyl-4`4-dione-monethyleneglycol keta;1,1'-BICYCLOHEXANE-4,4'DIONE MONOETHYLENE KETAL;4-(1,4-Dioxaspiro[4.5]dec-8-yl)cyclohexanone;4,4'-DICYCLOHEXANEDIONE MONOETHYLENE KETAL;DICYCLOHEXANE-4,4'-DIONE MONOETHYLENE KETAL;BICYCLOHEXYL-4,4'-DIONE-MONOETHYLENEGLYCOL KETAL;KETOKETAL | | CAS: | 56309-94-5 | | MF: | C14H22O3 | | MW: | 238.32 | | EINECS: | 423-860-2 | | Product Categories: | | | Mol File: | 56309-94-5.mol |  |
| | Ketoketal Chemical Properties |
| Melting point | 100.0 to 104.0 °C | | Boiling point | 365.4±42.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | vapor pressure | 0.064Pa at 20℃ | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C14H22O3/c15-13-3-1-11(2-4-13)12-5-7-14(8-6-12)16-9-10-17-14/h11-12H,1-10H2 | | InChIKey | ZNWLFTSPNBLXGL-UHFFFAOYSA-N | | SMILES | C1(=O)CCC(C2CCC3(OCCO3)CC2)CC1 | | LogP | 1.8 at 20℃ |
| | Ketoketal Usage And Synthesis |
| Chemical Properties | White solid | | Uses | Ketoketal is used as a pharmaceutical intermediate. | | Uses | Intermediates of Liquid Crystals | | Flammability and Explosibility | Not classified |
| | Ketoketal Preparation Products And Raw materials |
|