DIBROMOMALEIC ACID manufacturers
|
| | DIBROMOMALEIC ACID Basic information |
| | DIBROMOMALEIC ACID Chemical Properties |
| Melting point | ~125 °C (dec.) (lit.) | | Boiling point | 363.7±42.0 °C(Predicted) | | density | 2.4037 (rough estimate) | | refractive index | 1.4840 (estimate) | | pka | 0.01±0.44(Predicted) | | BRN | 1724799 | | InChI | 1S/C4H2Br2O4/c5-1(3(7)8)2(6)4(9)10/h(H,7,8)(H,9,10)/b2-1- | | InChIKey | PMNMPRXRQYSFRP-UPHRSURJSA-N | | SMILES | OC(=O)\C(Br)=C(\Br)C(O)=O | | EPA Substance Registry System | 2-Butenedioic acid, 2,3-dibromo-, (2Z)- (608-37-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-28-37 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | DIBROMOMALEIC ACID Usage And Synthesis |
| Chemical Properties | white to slightly yellow powder | | Purification Methods | It has been recrystallised from Et2O or Et2O/CHCl3. It is slightly soluble in H2O, soluble also in AcOH but insoluble in *C6H6 and CHCl3. [Salmony & Simonis Chem Ber 38 2583 1905, Ruggli Helv Chim Acta 3 566 1929, Beilstein 3 IV 2224.] |
| | DIBROMOMALEIC ACID Preparation Products And Raw materials |
|